chore: update dprint linters

feat(theme): improve light theme a bit
feat(theme): merge edge and connection color
2026-02-09 01:58:05 +01:00 · 2026-02-09 01:57:32 +01:00 · 2026-02-09 01:35:41 +01:00 · 2026-02-09 00:52:35 +01:00 · 2026-02-09 00:21:58 +01:00 · 2026-02-09 00:09:28 +01:00
79 changed files with 3239 additions and 901 deletions
--- a/.dprint.jsonc
+++ b/.dprint.jsonc
@@ -13,16 +13,12 @@
  "markdown": {},
  "toml": {},
  "dockerfile": {},
-  "ruff": {},
-  "jupyter": {},
-  "malva": {},
  "markup": {
    // https://dprint.dev/plugins/markup_fmt/config/
    "scriptIndent": true,
    "styleIndent": true,
  },
  "yaml": {},
-  "graphql": {},
  "exec": {
    "cwd": "${configDir}",
    "commands": [
@@ -46,20 +42,18 @@
    "**/*-lock.yaml",
    "**/yaml.lock",
    "**/.DS_Store",
+    "**/.pnpm-store",
+    "**/.cargo",
+    "**/target",
  ],
  "plugins": [
-    "https://plugins.dprint.dev/typescript-0.95.13.wasm",
+    "https://plugins.dprint.dev/typescript-0.95.15.wasm",
    "https://plugins.dprint.dev/json-0.21.1.wasm",
-    "https://plugins.dprint.dev/markdown-0.20.0.wasm",
+    "https://plugins.dprint.dev/markdown-0.21.1.wasm",
    "https://plugins.dprint.dev/toml-0.7.0.wasm",
    "https://plugins.dprint.dev/dockerfile-0.3.3.wasm",
-    "https://plugins.dprint.dev/ruff-0.6.11.wasm",
-    "https://plugins.dprint.dev/jupyter-0.2.1.wasm",
-    "https://plugins.dprint.dev/g-plane/malva-v0.15.1.wasm",
    "https://plugins.dprint.dev/g-plane/markup_fmt-v0.25.3.wasm",
-    "https://plugins.dprint.dev/g-plane/pretty_yaml-v0.5.1.wasm",
-    "https://plugins.dprint.dev/g-plane/pretty_graphql-v0.2.3.wasm",
+    "https://plugins.dprint.dev/g-plane/pretty_yaml-v0.6.0.wasm",
    "https://plugins.dprint.dev/exec-0.6.0.json@a054130d458f124f9b5c91484833828950723a5af3f8ff2bd1523bd47b83b364",
-    "https://plugins.dprint.dev/biome-0.11.10.wasm",
  ],
 }
--- a/.gitea/scripts/build.sh
+++ b/.gitea/scripts/build.sh
@@ -0,0 +1,45 @@
+#!/usr/bin/env bash
+set -euo pipefail
+
+mkdir -p app/static
+
+cp CHANGELOG.md app/static/CHANGELOG.md
+
+# Derive branch/tag info
+REF_TYPE="${GITHUB_REF_TYPE:-branch}"
+REF_NAME="${GITHUB_REF_NAME:-$(basename "$GITHUB_REF")}"
+BRANCH="${GITHUB_HEAD_REF:-}"
+if [[ -z "$BRANCH" && "$REF_TYPE" == "branch" ]]; then
+  BRANCH="$REF_NAME"
+fi
+
+# Determine last tag and commits since
+LAST_TAG="$(git describe --tags --abbrev=0 2>/dev/null || true)"
+if [[ -n "$LAST_TAG" ]]; then
+  COMMITS_SINCE_LAST_RELEASE="$(git rev-list --count "${LAST_TAG}..HEAD")"
+else
+  COMMITS_SINCE_LAST_RELEASE="0"
+fi
+
+commit_message=$(git log -1 --pretty=%B | tr -d '\n' | sed 's/"/\\"/g')
+
+cat >app/static/git.json <<EOF
+{
+  "ref": "${GITHUB_REF:-}",
+  "ref_name": "${REF_NAME}",
+  "ref_type": "${REF_TYPE}",
+  "sha": "${GITHUB_SHA:-}",
+  "run_number": "${GITHUB_RUN_NUMBER:-}",
+  "event_name": "${GITHUB_EVENT_NAME:-}",
+  "workflow": "${GITHUB_WORKFLOW:-}",
+  "job": "${GITHUB_JOB:-}",
+  "commit_message": "${commit_message}",
+  "commit_timestamp": "$(git log -1 --pretty=%cI)",
+  "branch": "${BRANCH}",
+  "commits_since_last_release": "${COMMITS_SINCE_LAST_RELEASE}"
+}
+EOF
+
+pnpm build
+
+cp -R packages/ui/build app/build/ui
--- a/.gitea/scripts/ci-checks.sh
+++ b/.gitea/scripts/ci-checks.sh
@@ -0,0 +1,18 @@
+#!/usr/bin/env bash
+set -euo pipefail
+
+pnpm build
+
+pnpm lint &
+LINT_PID=$!
+pnpm format:check &
+FORMAT_PID=$!
+pnpm check &
+TYPE_PID=$!
+xvfb-run --auto-servernum --server-args="-screen 0 1280x1024x24" pnpm test &
+TEST_PID=$!
+
+wait $LINT_PID
+wait $FORMAT_PID
+wait $TYPE_PID
+wait $TEST_PID
--- a/.gitea/scripts/create-release.sh
+++ b/.gitea/scripts/create-release.sh
@@ -1,20 +1,25 @@
-#!/usr/bin/env bash
-set -euo pipefail
+#!/bin/sh
+set -eu

 TAG="$GITHUB_REF_NAME"
-VERSION="${TAG#v}"
+VERSION=$(echo "$TAG" | sed 's/^v//')
 DATE=$(date +%Y-%m-%d)

-echo "🚀 Creating release for $TAG (safe mode)"
+echo "🚀 Creating release for $TAG"

 # -------------------------------------------------------------------
 # 1. Extract release notes from annotated tag
 # -------------------------------------------------------------------

-NOTES=$(git tag -l "$TAG" --format='%(contents)')
+# Ensure the local git knows this is an annotated tag with metadata
+git fetch origin "refs/tags/$TAG:refs/tags/$TAG" --force

-if [ -z "$NOTES" ]; then
-  echo "❌ Tag message is empty"
+# %(contents) gets the whole message.
+# If you want ONLY what you typed after the first line, use %(contents:body)
+NOTES=$(git tag -l "$TAG" --format='%(contents)' | sed '/-----BEGIN PGP SIGNATURE-----/,/-----END PGP SIGNATURE-----/d')
+
+if [ -z "$(echo "$NOTES" | tr -d '[:space:]')" ]; then
+  echo "❌ Tag message is empty or tag is not annotated"
  exit 1
 fi

@@ -23,51 +28,64 @@ git checkout main
 # -------------------------------------------------------------------
 # 2. Update all package.json versions
 # -------------------------------------------------------------------
-
 echo "🔧 Updating package.json versions to $VERSION"
-
-find . -name package.json -not -path "*/node_modules/*" | while read -r file; do
-  jq --arg v "$VERSION" '.version = $v' "$file" >"$file.tmp"
-  mv "$file.tmp" "$file"
+find . -name package.json ! -path "*/node_modules/*" | while read -r file; do
+  tmp_file="$file.tmp"
+  jq --arg v "$VERSION" '.version = $v' "$file" >"$tmp_file"
+  mv "$tmp_file" "$file"
 done

 # -------------------------------------------------------------------
-# 3. Update CHANGELOG.md (prepend)
+# 3. Generate commit list since last release
 # -------------------------------------------------------------------
+LAST_TAG=$(git tag --sort=-creatordate | grep -v "^$TAG$" | head -n 1 || echo "")

+if [ -n "$LAST_TAG" ]; then
+  # Filter out previous 'chore(release)' commits so the list stays clean
+  COMMITS=$(git log "$LAST_TAG"..HEAD --pretty=format:'* [%h](https://git.max-richter.dev/max/nodarium/commit/%H) %s' | grep -v "chore(release)")
+else
+  COMMITS=$(git log HEAD --pretty=format:'* [%h](https://git.max-richter.dev/max/nodarium/commit/%H) %s' | grep -v "chore(release)")
+fi
+
+# -------------------------------------------------------------------
+# 4. Update CHANGELOG.md (prepend)
+# -------------------------------------------------------------------
+tmp_changelog="CHANGELOG.tmp"
 {
-  echo "## $TAG ($DATE)"
+  echo "# $TAG ($DATE)"
  echo ""
  echo "$NOTES"
  echo ""
-  echo "---"
+  if [ -n "$COMMITS" ]; then
+    echo "---"
+    echo "$COMMITS"
+    echo ""
+  fi
  echo ""
-  cat CHANGELOG.md 2>/dev/null || true
-} >CHANGELOG.tmp
+  if [ -f CHANGELOG.md ]; then
+    cat CHANGELOG.md
+  fi
+} >"$tmp_changelog"

-mv CHANGELOG.tmp CHANGELOG.md
+mv "$tmp_changelog" CHANGELOG.md
+
+pnpm exec dprint fmt CHANGELOG.md

 # -------------------------------------------------------------------
-# 4. Create release commit
+# 5. Create release commit
 # -------------------------------------------------------------------
-
 git config user.name "release-bot"
 git config user.email "release-bot@ci"

-git add CHANGELOG.md $(find . -name package.json -not -path "*/node_modules/*")
+git add CHANGELOG.md $(find . -name package.json ! -path "*/node_modules/*")

-# Skip commit if nothing changed
 if git diff --cached --quiet; then
  echo "No changes to commit for release $TAG"
-  exit 0
+else
+  git commit -m "chore(release): $TAG"
+  git push origin main
 fi

-git commit -m "chore(release): $TAG"
-
-# -------------------------------------------------------------------
-# 5. Push changes
-# -------------------------------------------------------------------
-
-git push origin main
-
-echo "✅ Release commit for $TAG created successfully (tag untouched)"
+rm app/static/CHANGELOG.md
+cp CHANGELOG.md app/static/CHANGELOG.md
+echo "✅ Release process for $TAG complete"
--- a/.gitea/scripts/deploy-files.sh
+++ b/.gitea/scripts/deploy-files.sh
@@ -0,0 +1,43 @@
+#!/usr/bin/env bash
+set -euo pipefail
+
+echo "Configuring rclone"
+
+KEY_FILE="$(mktemp)"
+echo "${SSH_PRIVATE_KEY}" >"${KEY_FILE}"
+chmod 600 "${KEY_FILE}"
+
+mkdir -p ~/.config/rclone
+cat >~/.config/rclone/rclone.conf <<EOF
+[sftp-remote]
+type = sftp
+host = ${SSH_HOST}
+user = ${SSH_USER}
+port = ${SSH_PORT}
+key_file = ${KEY_FILE}
+EOF
+
+if [[ "${GITHUB_REF_TYPE:-}" == "tag" ]]; then
+  TARGET_DIR="${REMOTE_DIR}"
+elif [[ "${GITHUB_EVENT_NAME:-}" == "pull_request" ]]; then
+  SAFE_PR_NAME="${GITHUB_HEAD_REF//\//-}"
+  TARGET_DIR="${REMOTE_DIR}_${SAFE_PR_NAME}"
+elif [[ "${GITHUB_REF_NAME:-}" == "main" ]]; then
+  TARGET_DIR="${REMOTE_DIR}_main"
+else
+  SAFE_REF="${GITHUB_REF_NAME//\//-}"
+  TARGET_DIR="${REMOTE_DIR}_${SAFE_REF}"
+fi
+
+echo "Deploying to ${TARGET_DIR}"
+
+rclone sync \
+  --update \
+  --verbose \
+  --progress \
+  --exclude _astro/** \
+  --stats 2s \
+  --stats-one-line \
+  --transfers 4 \
+  ./app/build/ \
+  "sftp-remote:${TARGET_DIR}"
--- a/.gitea/workflows/build-ci-image.yaml
+++ b/.gitea/workflows/build-ci-image.yaml
@@ -0,0 +1,41 @@
+name: Build & Push CI Image
+
+on:
+  push:
+    branches:
+      - main
+    paths:
+      - "Dockerfile.ci"
+      - ".gitea/workflows/build-ci-image.yaml"
+
+jobs:
+  build-and-push:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Checkout repository
+        uses: actions/checkout@v4
+
+      - name: Set up Docker BuildX
+        uses: docker/setup-buildx-action@v2
+        with:
+          config-inline: |
+            [registry."git.max-richter.dev"]
+              https = true
+              insecure = false
+
+      - name: Login to Gitea Registry
+        uses: docker/login-action@v3
+        with:
+          registry: git.max-richter.dev
+          username: ${{ gitea.actor }}
+          password: ${{ secrets.REGISTRY_TOKEN }}
+
+      - name: Build and Push
+        uses: docker/build-push-action@v5
+        with:
+          context: .
+          file: ./Dockerfile.ci
+          push: true
+          tags: |
+            git.max-richter.dev/${{ gitea.repository }}-ci:latest
+            git.max-richter.dev/${{ gitea.repository }}-ci:${{ gitea.sha }}
--- a/.gitea/workflows/release.yaml
+++ b/.gitea/workflows/release.yaml
@@ -1,24 +1,28 @@
-name: 🚀 Release
+name: 🚀 Lint & Test & Deploy

 on:
  push:
    branches: ["*"]
    tags: ["*"]
+  pull_request:
+    branches: ["*"]

 env:
-  PNPM_CACHE_FOLDER: ~/.pnpm-store
+  PNPM_CACHE_FOLDER: .pnpm-store
+  CARGO_HOME: .cargo
+  CARGO_TARGET_DIR: target

 jobs:
  release:
    runs-on: ubuntu-latest
-    container: jimfx/nodes:latest
+    container: git.max-richter.dev/max/nodarium-ci:fd7268d6208aede435e1685817ae6b271c68bd83

    steps:
      - name: 📑 Checkout Code
        uses: actions/checkout@v4
        with:
          fetch-depth: 0
-          token: ${{ secrets.GITHUB_TOKEN }}
+          token: ${{ secrets.GITEA_TOKEN }}

      - name: 💾 Setup pnpm Cache
        uses: actions/cache@v4
@@ -28,31 +32,45 @@ jobs:
          restore-keys: |
            ${{ runner.os }}-pnpm-

+      - name: 🦀 Cache Cargo
+        uses: actions/cache@v4
+        with:
+          path: |
+            ~/.cargo/registry
+            ~/.cargo/git
+            target
+          key: ${{ runner.os }}-cargo-${{ hashFiles('**/Cargo.lock') }}
+          restore-keys: |
+            ${{ runner.os }}-cargo-
+
      - name: 📦 Install Dependencies
        run: pnpm install --frozen-lockfile --store-dir ${{ env.PNPM_CACHE_FOLDER }}

-      - name: 🧹 Lint
-        run: pnpm lint
-
-      - name: 🎨 Format Check
-        run: pnpm format:check
-
-      - name: 🧬 Type Check
-        run: pnpm check
+      - name: 🧹 Quality Control
+        run: ./.gitea/scripts/ci-checks.sh

      - name: 🛠️ Build
-        run: pnpm build:deploy
+        run: ./.gitea/scripts/build.sh

      - name: 🚀 Create Release Commit
-        if: github.ref_type == 'tag'
+        if: gitea.ref_type == 'tag'
        run: ./.gitea/scripts/create-release.sh

      - name: 🏷️ Create Gitea Release
-        if: github.ref_type == 'tag'
+        if: gitea.ref_type == 'tag'
        uses: akkuman/gitea-release-action@v1
        with:
-          tag_name: ${{ github.ref_name }}
-          release_name: Release ${{ github.ref_name }}
+          tag_name: ${{ gitea.ref_name }}
+          release_name: Release ${{ gitea.ref_name }}
          body_path: CHANGELOG.md
          draft: false
          prerelease: false
+
+      - name: 🚀 Deploy Changed Files via rclone
+        run: ./.gitea/scripts/deploy-files.sh
+        env:
+          REMOTE_DIR: ${{ vars.REMOTE_DIR }}
+          SSH_PRIVATE_KEY: ${{ secrets.SSH_PRIVATE_KEY }}
+          SSH_HOST: ${{ vars.SSH_HOST }}
+          SSH_PORT: ${{ vars.SSH_PORT }}
+          SSH_USER: ${{ vars.SSH_USER }}
--- a/CHANGELOG.md
+++ b/CHANGELOG.md
@@ -0,0 +1,70 @@
+# v0.0.3 (2026-02-07)
+
+## Features
+
+- Edge dragging now highlights valid connection sockets, improving graph editing clarity.
+- InputNumber supports snapping to predefined values while holding Alt.
+- Changelog is accessible directly from the sidebar and now includes git metadata and a list of commits.
+
+## Fixes
+
+- Fixed incorrect socket highlighting when an edge already existed.
+- Corrected initialization of `InputNumber` values outside min/max bounds.
+- Fixed initialization of nested vec3 inputs.
+- Multiple CI fixes to ensure reliable builds, correct environment variables, and proper image handling.
+
+## Maintenance / CI
+
+- Significant CI and Dockerfile cleanup and optimization.
+- Improved git metadata generation during builds.
+- Dependency updates, formatting, and test snapshot updates.
+
+---
+
+- [f8a2a95](https://git.max-richter.dev/max/nodarium/commit/f8a2a95bc18fa3c8c1db67dc0c2b66db1ff0d866) chore: clean CHANGELOG.md
+- [c9dd143](https://git.max-richter.dev/max/nodarium/commit/c9dd143916d758991f3ba30723a32c18b6f98bb5) fix(ci): correctly add release notes from tag to changelog
+- [898dd49](https://git.max-richter.dev/max/nodarium/commit/898dd49aee930350af8645382ef5042765a1fac7) fix(ci): correctly copy changelog to build output
+- [9fb69d7](https://git.max-richter.dev/max/nodarium/commit/9fb69d760fdf92ecc2448e468242970ec48443b0) feat: show commits since last release in changelog
+- [bafbcca](https://git.max-richter.dev/max/nodarium/commit/bafbcca2b8a7cd9f76e961349f11ec84d1e4da63) fix: wrong socket was highlighted when dragging node
+- [8ad9e55](https://git.max-richter.dev/max/nodarium/commit/8ad9e5535cd752ef111504226b4dac57b5adcf3d) feat: highlight possible sockets when dragging edge
+- [11eaeb7](https://git.max-richter.dev/max/nodarium/commit/11eaeb719be7f34af8db8b7908008a15308c0cac) feat(app): display some git metadata in changelog
+- [74c2978](https://git.max-richter.dev/max/nodarium/commit/74c2978cd16d2dd95ce1ae8019dfb9098e52b4b6) chore: cleanup git.json a bit
+- [4fdc247](https://git.max-richter.dev/max/nodarium/commit/4fdc24790490d3f13ee94a557159617f4077a2f9) ci: update build.sh to correct git.json
+- [c3f8b4b](https://git.max-richter.dev/max/nodarium/commit/c3f8b4b5aad7a525fb11ab14c9236374cb60442d) ci: debug available env vars
+- [67591c0](https://git.max-richter.dev/max/nodarium/commit/67591c0572b873d8c7cd00db8efb7dac2d6d4de2) chore: pnpm format
+- [de1f9d6](https://git.max-richter.dev/max/nodarium/commit/de1f9d6ab669b8e699d98b8855e125e21030b5b3) feat(ui): change inputnumber to snap to values when alt is pressed
+- [6acce72](https://git.max-richter.dev/max/nodarium/commit/6acce72fb8c416cc7f6eec99c2ae94d6529e960c) fix(ui): correctly initialize InputNumber
+- [cf8943b](https://git.max-richter.dev/max/nodarium/commit/cf8943b2059aa286e41865caf75058d35498daf7) chore: pnpm update
+- [9e03d36](https://git.max-richter.dev/max/nodarium/commit/9e03d36482bb4f972c384b66b2dcf258f0cd18be) chore: use newest ci image
+- [fd7268d](https://git.max-richter.dev/max/nodarium/commit/fd7268d6208aede435e1685817ae6b271c68bd83) ci: make dockerfile work
+- [6358c22](https://git.max-richter.dev/max/nodarium/commit/6358c22a853ec340be5223fabb8289092e4f4afe) ci: use tagged own image for ci
+- [655b6a1](https://git.max-richter.dev/max/nodarium/commit/655b6a18b282f0cddcc750892e575ee6c311036b) ci: make dockerfile work
+- [37b2bdc](https://git.max-richter.dev/max/nodarium/commit/37b2bdc8bdbd8ded6b22b89214b49de46f788351) ci: update ci Dockerfile to work
+- [94e01d4](https://git.max-richter.dev/max/nodarium/commit/94e01d4ea865f15ce06b52827a1ae6906de5be5e) ci: correctly build and push ci image
+- [35f5177](https://git.max-richter.dev/max/nodarium/commit/35f5177884b62bbf119af1bbf4df61dd0291effb) feat: try to optimize the Dockerfile
+- [ac2c61f](https://git.max-richter.dev/max/nodarium/commit/ac2c61f2211ba96bbdbb542179905ca776537cec) ci: use actual git url in ci
+- [ef3d462](https://git.max-richter.dev/max/nodarium/commit/ef3d46279f4ff9c04d80bb2d9a9e7cfec63b224e) fix(ci): build before testing
+- [703da32](https://git.max-richter.dev/max/nodarium/commit/703da324fabbef0e2c017f0f7a925209fa26bd03) ci: automatically build ci image and store locally
+- [1dae472](https://git.max-richter.dev/max/nodarium/commit/1dae472253ccb5e3766f2270adc053b922f46738) ci: add a git.json metadata file during build
+- [09fdfb8](https://git.max-richter.dev/max/nodarium/commit/09fdfb88cd203ace0e36663ebdb2c8c7ba53f190) chore: update test screenshots
+- [04b63cc](https://git.max-richter.dev/max/nodarium/commit/04b63cc7e2fc4fcfa0973cf40592d11457179db3) feat: add changelog to sidebar
+- [cb6a356](https://git.max-richter.dev/max/nodarium/commit/cb6a35606dfda50b0c81b04902d7a6c8e59458d2) feat(ci): also cache cargo stuff
+- [9c9f3ba](https://git.max-richter.dev/max/nodarium/commit/9c9f3ba3b7c94215a86b0a338a5cecdd87b96b28) fix(ci): use GITHUB_instead of GITEA_ for env vars
+- [08dda2b](https://git.max-richter.dev/max/nodarium/commit/08dda2b2cb4d276846abe30bc260127626bb508a) chore: pnpm format
+- [059129a](https://git.max-richter.dev/max/nodarium/commit/059129a738d02b8b313bb301a515697c7c4315ac) fix(ci): deploy prs and main
+- [437c9f4](https://git.max-richter.dev/max/nodarium/commit/437c9f4a252125e1724686edace0f5f006f58439) feat(ci): add list of all commits to changelog entry
+- [48bf447](https://git.max-richter.dev/max/nodarium/commit/48bf447ce12949d7c29a230806d160840b7847e1) docs: straighten up changelog a bit
+- [548fa4f](https://git.max-richter.dev/max/nodarium/commit/548fa4f0a1a14adc40a74da1182fa6da81eab3df) fix(app): correctly initialize vec3 inputs in nestedsettings
+
+# v0.0.2 (2026-02-04)
+
+## Fixes
+
+---
+
+- []() fix(ci): actually deploy on tags
+- []() fix(app): correctly handle false value in settings
+
+# v0.0.1 (2026-02-03)
+
+chore: format
--- a/Cargo.lock
+++ b/Cargo.lock
@@ -245,6 +245,14 @@ dependencies = [
 "zmij",
 ]

+[[package]]
+name = "shape"
+version = "0.1.0"
+dependencies = [
+ "nodarium_macros",
+ "nodarium_utils",
+]
+
 [[package]]
 name = "stem"
 version = "0.1.0"
--- a/15
+++ b/15
@@ -1,15 +0,0 @@
-FROM node:24-alpine
-
-RUN apk add --no-cache --update curl rclone g++
-
-ENV RUSTUP_HOME=/usr/local/rustup \
-    CARGO_HOME=/usr/local/cargo \
-    PATH=/usr/local/cargo/bin:$PATH
-
-RUN curl --silent --show-error --location --fail --retry 3 \
-  --proto '=https' --tlsv1.2 \
-  --output /tmp/rustup-init.sh https://sh.rustup.rs \
-  && sh /tmp/rustup-init.sh -y --no-modify-path --profile minimal \
-  && rm /tmp/rustup-init.sh \
-  && rustup target add wasm32-unknown-unknown \
-  && npm i -g pnpm
--- a/Dockerfile.ci
+++ b/Dockerfile.ci
@@ -0,0 +1,30 @@
+FROM node:25-bookworm-slim
+
+ENV RUSTUP_HOME=/usr/local/rustup \
+  CARGO_HOME=/usr/local/cargo \
+  PATH=/usr/local/cargo/bin:$PATH
+
+RUN apt-get update && apt-get install -y \
+  ca-certificates=20230311+deb12u1 \
+  curl=7.88.1-10+deb12u14 \
+  git=1:2.39.5-0+deb12u3 \
+  jq=1.6-2.1+deb12u1 \
+  g++=4:12.2.0-3 \
+  rclone=1.60.1+dfsg-2+b5 \
+  xvfb=2:21.1.7-3+deb12u11 \
+  xauth=1:1.1.2-1 \
+  --no-install-recommends \
+  # Install Rust
+  && curl --proto '=https' --tlsv1.2 -sSf https://sh.rustup.rs | sh -s -- -y \
+  --default-toolchain stable \
+  --profile minimal \
+  && rustup target add wasm32-unknown-unknown \
+  # Setup Playwright
+  && npm i -g pnpm \
+  && pnpm dlx playwright install --with-deps firefox \
+  # Final Cleanup
+  && rm -rf /usr/local/rustup/downloads /usr/local/rustup/tmp \ 
+  && rm -rf /usr/local/cargo/registry/index /usr/local/cargo/registry/cache \ 
+  && rm -rf /usr/local/rustup/toolchains/*/share/doc \ 
+  && apt-get purge -y --auto-remove \ 
+  && rm -rf /var/lib/apt/lists/*
--- a/app/.gitignore
+++ b/app/.gitignore
@@ -27,3 +27,5 @@ dist-ssr
 *.sln
 *.sw?
 build/
+
+test-results/
--- a/app/e2e/main.test.ts
+++ b/app/e2e/main.test.ts
@@ -0,0 +1,62 @@
+import { expect, test } from '@playwright/test';
+
+test('test', async ({ page }) => {
+  // Listen for console messages
+  page.on('console', msg => {
+    console.log(`[Browser Console] ${msg.type()}: ${msg.text()}`);
+  });
+
+  await page.goto('http://localhost:4173', { waitUntil: 'load' });
+
+  // await expect(page).toHaveScreenshot();
+  await expect(page.locator('.graph-wrapper')).toHaveScreenshot();
+
+  await page.getByRole('button', { name: 'projects' }).click();
+  await page.getByRole('button', { name: 'New', exact: true }).click();
+  await page.getByRole('combobox').selectOption('2');
+  await page.getByRole('textbox', { name: 'Project name' }).click();
+  await page.getByRole('textbox', { name: 'Project name' }).fill('Test Project');
+  await page.getByRole('button', { name: 'Create' }).click();
+
+  const expectedNodes = [
+    {
+      id: '10',
+      type: 'max/plantarium/stem',
+      props: {
+        amount: 50,
+        length: 4,
+        thickness: 1
+      }
+    },
+    {
+      id: '11',
+      type: 'max/plantarium/noise',
+      props: {
+        scale: 0.5,
+        strength: 5
+      }
+    },
+    {
+      id: '9',
+      type: 'max/plantarium/output'
+    }
+  ];
+
+  for (const node of expectedNodes) {
+    const wrapper = page.locator(
+      `div.wrapper[data-node-id="${node.id}"][data-node-type="${node.type}"]`
+    );
+    await expect(wrapper).toBeVisible();
+    if ('props' in node) {
+      const props = node.props as unknown as Record<string, number>;
+      for (const propId in node.props) {
+        const expectedValue = props[propId];
+        const inputElement = page.locator(
+          `div.wrapper[data-node-type="${node.type}"][data-node-input="${propId}"] input[type="number"]`
+        );
+        const value = parseFloat(await inputElement.inputValue());
+        expect(value).toBe(expectedValue);
+      }
+    }
+  }
+});
--- a/app/e2e/main.test.ts-snapshots/test-1-linux.png
+++ b/app/e2e/main.test.ts-snapshots/test-1-linux.png
--- a/app/package.json
+++ b/app/package.json
@@ -1,12 +1,14 @@
 {
  "name": "@nodarium/app",
  "private": true,
-  "version": "0.0.0",
+  "version": "0.0.3",
  "type": "module",
  "scripts": {
    "dev": "vite dev",
    "build": "svelte-kit sync && vite build",
-    "test": "vitest",
+    "test:unit": "vitest",
+    "test": "npm run test:unit -- --run && npm run test:e2e",
+    "test:e2e": "playwright test",
    "preview": "vite preview",
    "format": "dprint fmt -c '../.dprint.jsonc' .",
    "format:check": "dprint check -c '../.dprint.jsonc' .",
@@ -16,7 +18,7 @@
  "dependencies": {
    "@nodarium/ui": "workspace:*",
    "@nodarium/utils": "workspace:*",
-    "@sveltejs/kit": "^2.50.0",
+    "@sveltejs/kit": "^2.50.2",
    "@tailwindcss/vite": "^4.1.18",
    "@threlte/core": "8.3.1",
    "@threlte/extras": "9.7.1",
@@ -24,27 +26,29 @@
    "file-saver": "^2.0.5",
    "idb": "^8.0.3",
    "jsondiffpatch": "^0.7.3",
+    "micromark": "^4.0.2",
    "tailwindcss": "^4.1.18",
-    "three": "^0.182.0",
-    "wabt": "^1.0.39"
+    "three": "^0.182.0"
  },
  "devDependencies": {
    "@eslint/compat": "^2.0.2",
    "@eslint/js": "^9.39.2",
    "@iconify-json/tabler": "^1.2.26",
    "@iconify/tailwind4": "^1.2.1",
-    "@nodarium/types": "workspace:",
+    "@nodarium/types": "workspace:^",
+    "@playwright/test": "^1.58.1",
    "@sveltejs/adapter-static": "^3.0.10",
    "@sveltejs/vite-plugin-svelte": "^6.2.4",
-    "@tsconfig/svelte": "^5.0.6",
+    "@tsconfig/svelte": "^5.0.7",
    "@types/file-saver": "^2.0.7",
    "@types/three": "^0.182.0",
+    "@vitest/browser-playwright": "^4.0.18",
    "dprint": "^0.51.1",
    "eslint": "^9.39.2",
    "eslint-plugin-svelte": "^3.14.0",
    "globals": "^17.3.0",
-    "svelte": "^5.46.4",
-    "svelte-check": "^4.3.5",
+    "svelte": "^5.49.2",
+    "svelte-check": "^4.3.6",
    "tslib": "^2.8.1",
    "typescript": "^5.9.3",
    "typescript-eslint": "^8.54.0",
@@ -52,6 +56,7 @@
    "vite-plugin-comlink": "^5.3.0",
    "vite-plugin-glsl": "^1.5.5",
    "vite-plugin-wasm": "^3.5.0",
-    "vitest": "^4.0.17"
+    "vitest": "^4.0.18",
+    "vitest-browser-svelte": "^2.0.2"
  }
 }
--- a/app/playwright.config.ts
+++ b/app/playwright.config.ts
@@ -0,0 +1,20 @@
+import { defineConfig } from '@playwright/test';
+
+export default defineConfig({
+  webServer: { command: 'pnpm build && pnpm preview', port: 4173 },
+  testDir: 'e2e',
+  use: {
+    browserName: 'firefox',
+    launchOptions: {
+      firefoxUserPrefs: {
+        // Force WebGL even without a GPU
+        'webgl.force-enabled': true,
+        'webgl.disabled': false,
+        // Use software rendering (Mesa) instead of hardware
+        'layers.acceleration.disabled': true,
+        'gfx.webrender.software': true,
+        'webgl.enable-webgl2': true
+      }
+    }
+  }
+});
--- a/app/src/app.css
+++ b/app/src/app.css
@@ -2,7 +2,7 @@
@source "../../packages/ui/**/*.svelte";
@plugin "@iconify/tailwind4" {
  prefix: "i";
-  icon-sets: from-folder(custom, "./src/lib/icons");
+  icon-sets: from-folder("custom", "./src/lib/icons");
 }

 body * {
--- a/app/src/lib/graph-interface/edges/Edge.svelte
+++ b/app/src/lib/graph-interface/edges/Edge.svelte
@@ -2,19 +2,19 @@
  import { colors } from '../graph/colors.svelte';

  const circleMaterial = new MeshBasicMaterial({
-    color: colors.edge.clone(),
+    color: colors.connection.clone(),
    toneMapped: false
  });

-  let lineColor = $state(colors.edge.clone().convertSRGBToLinear());
+  let lineColor = $state(colors.connection.clone().convertSRGBToLinear());

  $effect.root(() => {
    $effect(() => {
      if (appSettings.value.theme === undefined) {
        return;
      }
-      circleMaterial.color = colors.edge.clone().convertSRGBToLinear();
-      lineColor = colors.edge.clone().convertSRGBToLinear();
+      circleMaterial.color = colors.connection.clone().convertSRGBToLinear();
+      lineColor = colors.connection.clone().convertSRGBToLinear();
    });
  });

--- a/app/src/lib/graph-interface/graph-manager.svelte.test.ts
+++ b/app/src/lib/graph-interface/graph-manager.svelte.test.ts
@@ -0,0 +1,265 @@
+import { describe, expect, it } from 'vitest';
+import { GraphManager } from './graph-manager.svelte';
+import {
+  createMockNodeRegistry,
+  mockFloatInputNode,
+  mockFloatOutputNode,
+  mockGeometryOutputNode,
+  mockPathInputNode,
+  mockVec3OutputNode
+} from './test-utils';
+
+describe('GraphManager', () => {
+  describe('getPossibleSockets', () => {
+    describe('when dragging an output socket', () => {
+      it('should return compatible input sockets based on type', () => {
+        const registry = createMockNodeRegistry([
+          mockFloatOutputNode,
+          mockFloatInputNode,
+          mockGeometryOutputNode,
+          mockPathInputNode
+        ]);
+
+        const manager = new GraphManager(registry);
+
+        const floatInputNode = manager.createNode({
+          type: 'test/node/input',
+          position: [100, 100],
+          props: {}
+        });
+
+        const floatOutputNode = manager.createNode({
+          type: 'test/node/output',
+          position: [0, 0],
+          props: {}
+        });
+
+        expect(floatInputNode).toBeDefined();
+        expect(floatOutputNode).toBeDefined();
+
+        const possibleSockets = manager.getPossibleSockets({
+          node: floatOutputNode!,
+          index: 0,
+          position: [0, 0]
+        });
+
+        expect(possibleSockets.length).toBe(1);
+        const socketNodeIds = possibleSockets.map(([node]) => node.id);
+        expect(socketNodeIds).toContain(floatInputNode!.id);
+      });
+
+      it('should exclude self node from possible sockets', () => {
+        const registry = createMockNodeRegistry([
+          mockFloatOutputNode,
+          mockFloatInputNode
+        ]);
+
+        const manager = new GraphManager(registry);
+
+        const floatInputNode = manager.createNode({
+          type: 'test/node/input',
+          position: [100, 100],
+          props: {}
+        });
+
+        expect(floatInputNode).toBeDefined();
+
+        const possibleSockets = manager.getPossibleSockets({
+          node: floatInputNode!,
+          index: 'value',
+          position: [0, 0]
+        });
+
+        const socketNodeIds = possibleSockets.map(([node]) => node.id);
+        expect(socketNodeIds).not.toContain(floatInputNode!.id);
+      });
+
+      it('should exclude parent nodes from possible sockets when dragging output', () => {
+        const registry = createMockNodeRegistry([
+          mockFloatOutputNode,
+          mockFloatInputNode
+        ]);
+
+        const manager = new GraphManager(registry);
+
+        const parentNode = manager.createNode({
+          type: 'test/node/output',
+          position: [0, 0],
+          props: {}
+        });
+
+        const childNode = manager.createNode({
+          type: 'test/node/input',
+          position: [100, 100],
+          props: {}
+        });
+
+        expect(parentNode).toBeDefined();
+        expect(childNode).toBeDefined();
+
+        if (parentNode && childNode) {
+          manager.createEdge(parentNode, 0, childNode, 'value');
+        }
+
+        const possibleSockets = manager.getPossibleSockets({
+          node: parentNode!,
+          index: 0,
+          position: [0, 0]
+        });
+
+        const socketNodeIds = possibleSockets.map(([node]) => node.id);
+        expect(socketNodeIds).not.toContain(childNode!.id);
+      });
+
+      it('should return sockets compatible with accepts property', () => {
+        const registry = createMockNodeRegistry([
+          mockGeometryOutputNode,
+          mockPathInputNode
+        ]);
+
+        const manager = new GraphManager(registry);
+
+        const geometryOutputNode = manager.createNode({
+          type: 'test/node/geometry',
+          position: [0, 0],
+          props: {}
+        });
+
+        const pathInputNode = manager.createNode({
+          type: 'test/node/path',
+          position: [100, 100],
+          props: {}
+        });
+
+        expect(geometryOutputNode).toBeDefined();
+        expect(pathInputNode).toBeDefined();
+
+        const possibleSockets = manager.getPossibleSockets({
+          node: geometryOutputNode!,
+          index: 0,
+          position: [0, 0]
+        });
+
+        const socketNodeIds = possibleSockets.map(([node]) => node.id);
+        expect(socketNodeIds).toContain(pathInputNode!.id);
+      });
+
+      it('should return empty array when no compatible sockets exist', () => {
+        const registry = createMockNodeRegistry([
+          mockVec3OutputNode,
+          mockFloatInputNode
+        ]);
+
+        const manager = new GraphManager(registry);
+
+        const vec3OutputNode = manager.createNode({
+          type: 'test/node/vec3',
+          position: [0, 0],
+          props: {}
+        });
+
+        const floatInputNode = manager.createNode({
+          type: 'test/node/input',
+          position: [100, 100],
+          props: {}
+        });
+
+        expect(vec3OutputNode).toBeDefined();
+        expect(floatInputNode).toBeDefined();
+
+        const possibleSockets = manager.getPossibleSockets({
+          node: vec3OutputNode!,
+          index: 0,
+          position: [0, 0]
+        });
+
+        const socketNodeIds = possibleSockets.map(([node]) => node.id);
+        expect(socketNodeIds).not.toContain(floatInputNode!.id);
+        expect(possibleSockets.length).toBe(0);
+      });
+
+      it('should return socket info with correct socket key for inputs', () => {
+        const registry = createMockNodeRegistry([
+          mockFloatOutputNode,
+          mockFloatInputNode
+        ]);
+
+        const manager = new GraphManager(registry);
+
+        const floatOutputNode = manager.createNode({
+          type: 'test/node/output',
+          position: [0, 0],
+          props: {}
+        });
+
+        const floatInputNode = manager.createNode({
+          type: 'test/node/input',
+          position: [100, 100],
+          props: {}
+        });
+
+        expect(floatOutputNode).toBeDefined();
+        expect(floatInputNode).toBeDefined();
+
+        const possibleSockets = manager.getPossibleSockets({
+          node: floatOutputNode!,
+          index: 0,
+          position: [0, 0]
+        });
+
+        const matchingSocket = possibleSockets.find(([node]) => node.id === floatInputNode!.id);
+        expect(matchingSocket).toBeDefined();
+        expect(matchingSocket![1]).toBe('value');
+      });
+
+      it('should return multiple compatible sockets', () => {
+        const registry = createMockNodeRegistry([
+          mockFloatOutputNode,
+          mockFloatInputNode,
+          mockGeometryOutputNode,
+          mockPathInputNode
+        ]);
+
+        const manager = new GraphManager(registry);
+
+        const floatOutputNode = manager.createNode({
+          type: 'test/node/output',
+          position: [0, 0],
+          props: {}
+        });
+
+        const geometryOutputNode = manager.createNode({
+          type: 'test/node/geometry',
+          position: [200, 0],
+          props: {}
+        });
+
+        const floatInputNode = manager.createNode({
+          type: 'test/node/input',
+          position: [100, 100],
+          props: {}
+        });
+
+        const pathInputNode = manager.createNode({
+          type: 'test/node/path',
+          position: [300, 100],
+          props: {}
+        });
+
+        expect(floatOutputNode).toBeDefined();
+        expect(geometryOutputNode).toBeDefined();
+        expect(floatInputNode).toBeDefined();
+        expect(pathInputNode).toBeDefined();
+
+        const possibleSocketsForFloat = manager.getPossibleSockets({
+          node: floatOutputNode!,
+          index: 0,
+          position: [0, 0]
+        });
+
+        expect(possibleSocketsForFloat.length).toBe(1);
+        expect(possibleSocketsForFloat.map(([n]) => n.id)).toContain(floatInputNode!.id);
+      });
+    });
+  });
+});
--- a/app/src/lib/graph-interface/graph-manager.svelte.ts
+++ b/app/src/lib/graph-interface/graph-manager.svelte.ts
@@ -757,12 +757,16 @@ export class GraphManager extends EventEmitter<{
        (n) => n.id !== node.id && !parents.has(n.id)
      );

-      // get edges from this socket
-      const edges = new SvelteMap(
-        this.getEdgesFromNode(node)
-          .filter((e) => e[1] === index)
-          .map((e) => [e[2].id, e[3]])
-      );
+      const edges = new SvelteMap<number, string[]>();
+      this.getEdgesFromNode(node)
+        .filter((e) => e[1] === index)
+        .forEach((e) => {
+          if (edges.has(e[2].id)) {
+            edges.get(e[2].id)?.push(e[3]);
+          } else {
+            edges.set(e[2].id, [e[3]]);
+          }
+        });

      const ownType = nodeType.outputs?.[index];

@@ -775,7 +779,7 @@ export class GraphManager extends EventEmitter<{

          if (
            areSocketsCompatible(ownType, otherType)
-            && edges.get(node.id) !== key
+            && !edges.get(node.id)?.includes(key)
          ) {
            sockets.push([node, key]);
          }
--- a/app/src/lib/graph-interface/graph-state.svelte.ts
+++ b/app/src/lib/graph-interface/graph-state.svelte.ts
@@ -186,15 +186,21 @@ export class GraphState {
    if (!node?.inputs) {
      return 5;
    }
-    const height = 5
-      + 10
-        * Object.keys(node.inputs).filter(
-          (p) =>
-            p !== 'seed'
-            && node?.inputs
-            && !(node?.inputs?.[p] !== undefined && 'setting' in node.inputs[p])
-            && node.inputs[p].hidden !== true
-        ).length;
+    let height = 5;
+
+    for (const key of Object.keys(node.inputs)) {
+      if (key === 'seed') continue;
+      if (!node.inputs) continue;
+      if (node?.inputs?.[key] === undefined) continue;
+      if ('setting' in node.inputs[key]) continue;
+      if (node.inputs[key].hidden) continue;
+      if (node.inputs[key].type === 'shape') {
+        height += 20;
+        continue;
+      }
+      height += 10;
+    }
+
    this.nodeHeightCache[nodeTypeId] = height;
    return height;
  }
--- a/app/src/lib/graph-interface/graph/colors.svelte.ts
+++ b/app/src/lib/graph-interface/graph/colors.svelte.ts
@@ -9,7 +9,7 @@ const variables = [
  'outline',
  'active',
  'selected',
-  'edge'
+  'connection'
 ] as const;

 function getColor(variable: (typeof variables)[number]) {
--- a/app/src/lib/graph-interface/graph/mouse.events.ts
+++ b/app/src/lib/graph-interface/graph/mouse.events.ts
@@ -166,15 +166,14 @@ export class MouseEventManager {

    if (this.state.mouseDown) return;
    this.state.edgeEndPosition = null;
+    const target = event.target as HTMLElement;

-    if (event.target instanceof HTMLElement) {
-      if (
-        event.target.nodeName !== 'CANVAS'
-        && !event.target.classList.contains('node')
-        && !event.target.classList.contains('content')
-      ) {
-        return;
-      }
+    if (
+      target.nodeName !== 'CANVAS'
+      && !target.classList.contains('node')
+      && !target.classList.contains('content')
+    ) {
+      return;
    }

    const mx = event.clientX - this.state.rect.x;
@@ -265,7 +264,7 @@ export class MouseEventManager {
        }
      }

-      if (_socket && smallestDist < 0.9) {
+      if (_socket && smallestDist < 1.5) {
        this.state.mousePosition = _socket.position;
        this.state.hoveredSocket = _socket;
      } else {
--- a/app/src/lib/graph-interface/node/NodeHeader.svelte
+++ b/app/src/lib/graph-interface/node/NodeHeader.svelte
@@ -35,8 +35,8 @@
  );
  const pathHover = $derived(
    createNodePath({
-      depth: 8.5,
-      height: 50,
+      depth: 7,
+      height: 40,
      y: 49,
      cornerTop,
      rightBump,
@@ -113,6 +113,9 @@
    stroke: var(--stroke);
    stroke-width: var(--stroke-width);
    d: var(--path);
+
+    stroke-linejoin: round;
+    shape-rendering: geometricPrecision;
  }

  .content {
--- a/app/src/lib/graph-interface/node/NodeParameter.svelte
+++ b/app/src/lib/graph-interface/node/NodeParameter.svelte
@@ -18,6 +18,7 @@
  const inputType = $derived(node?.state?.type?.inputs?.[id]);

  const socketId = $derived(`${node.id}-${id}`);
+  const height = $derived(input.type === 'shape' ? 200 : 100);

  const graphState = getGraphState();
  const graphId = graph?.id;
@@ -39,16 +40,6 @@
  const aspectRatio = 0.5;

  const path = $derived(
-    createNodePath({
-      depth: 7,
-      height: 20,
-      y: 50.5,
-      cornerBottom,
-      leftBump,
-      aspectRatio
-    })
-  );
-  const pathDisabled = $derived(
    createNodePath({
      depth: 6,
      height: 18,
@@ -60,8 +51,8 @@
  );
  const pathHover = $derived(
    createNodePath({
-      depth: 8,
-      height: 25,
+      depth: 7,
+      height: 20,
      y: 50.5,
      cornerBottom,
      leftBump,
@@ -74,7 +65,8 @@
  class="wrapper"
  data-node-type={node.type}
  data-node-input={id}
-  class:disabled={!graphState?.possibleSocketIds.has(socketId)}
+  style:height="{height}px"
+  class:possible-socket={graphState?.possibleSocketIds.has(socketId)}
 >
  {#key id && graphId}
    <div class="content" class:disabled={graph?.inputSockets?.has(socketId)}>
@@ -91,10 +83,9 @@
    </div>

    {#if node?.state?.type?.inputs?.[id]?.internal !== true}
-      <div data-node-socket class="large target"></div>
      <div
        data-node-socket
-        class="small target"
+        class="target"
        onmousedown={handleMouseDown}
        role="button"
        tabindex="0"
@@ -106,13 +97,10 @@
  <svg
    xmlns="http://www.w3.org/2000/svg"
    viewBox="0 0 100 100"
-    width="100"
-    height="100"
    preserveAspectRatio="none"
    style={`
      --path: path("${path}");
      --hover-path: path("${pathHover}");
-      --hover-path-disabled: path("${pathDisabled}");
    `}
  >
    <path vector-effect="non-scaling-stroke"></path>
@@ -123,33 +111,26 @@
  .wrapper {
    position: relative;
    width: 100%;
-    height: 100px;
    transform: translateY(-0.5px);
  }

  .target {
+    width: 30px;
+    height: 30px;
    position: absolute;
    border-radius: 50%;
    top: 50%;
    transform: translateY(-50%) translateX(-50%);
-    /* background: red; */
-    /* opacity: 0.1; */
  }

-  .small.target {
-    width: 30px;
-    height: 30px;
+  .possible-socket .target {
+    box-shadow: 0px 0px 10px rgba(255, 255, 255, 0.5);
+    background-color: rgba(255, 255, 255, 0.2);
+    z-index: -10;
  }

-  .large.target {
-    width: 60px;
-    height: 60px;
-    cursor: unset;
-    pointer-events: none;
-  }
-
-  :global(.hovering-sockets) .large.target {
-    pointer-events: all;
+  .target:hover ~ svg path{
+    d: var(--hover-path);
  }

  .content {
@@ -179,19 +160,16 @@
    stroke: var(--stroke);
    stroke-width: var(--stroke-width);
    d: var(--path);
-  }

-  :global {
-    .hovering-sockets .large:hover ~ svg path {
-      d: var(--hover-path);
-    }
+    stroke-linejoin: round;
+    shape-rendering: geometricPrecision;
  }

  .content.disabled {
    opacity: 0.2;
  }

-  .disabled svg path {
-    d: var(--hover-path-disabled) !important;
+  .possible-socket svg path {
+     d: var(--hover-path);
  }
 </style>
--- a/app/src/lib/graph-interface/test-utils.ts
+++ b/app/src/lib/graph-interface/test-utils.ts
@@ -0,0 +1,86 @@
+import type { NodeDefinition, NodeId, NodeRegistry } from '@nodarium/types';
+
+export function createMockNodeRegistry(nodes: NodeDefinition[]): NodeRegistry {
+  const nodesMap = new Map(nodes.map(n => [n.id, n]));
+  return {
+    status: 'ready' as const,
+    load: async (nodeIds: NodeId[]) => {
+      const loaded: NodeDefinition[] = [];
+      for (const id of nodeIds) {
+        if (nodesMap.has(id)) {
+          loaded.push(nodesMap.get(id)!);
+        }
+      }
+      return loaded;
+    },
+    getNode: (id: string) => nodesMap.get(id as NodeId),
+    getAllNodes: () => Array.from(nodesMap.values()),
+    register: async () => {
+      throw new Error('Not implemented in mock');
+    }
+  };
+}
+
+export const mockFloatOutputNode: NodeDefinition = {
+  id: 'test/node/output',
+  inputs: {},
+  outputs: ['float'],
+  meta: { title: 'Float Output' },
+  execute: () => new Int32Array()
+};
+
+export const mockFloatInputNode: NodeDefinition = {
+  id: 'test/node/input',
+  inputs: { value: { type: 'float' } },
+  outputs: [],
+  meta: { title: 'Float Input' },
+  execute: () => new Int32Array()
+};
+
+export const mockGeometryOutputNode: NodeDefinition = {
+  id: 'test/node/geometry',
+  inputs: {},
+  outputs: ['geometry'],
+  meta: { title: 'Geometry Output' },
+  execute: () => new Int32Array()
+};
+
+export const mockPathInputNode: NodeDefinition = {
+  id: 'test/node/path',
+  inputs: { input: { type: 'path', accepts: ['geometry'] } },
+  outputs: [],
+  meta: { title: 'Path Input' },
+  execute: () => new Int32Array()
+};
+
+export const mockVec3OutputNode: NodeDefinition = {
+  id: 'test/node/vec3',
+  inputs: {},
+  outputs: ['vec3'],
+  meta: { title: 'Vec3 Output' },
+  execute: () => new Int32Array()
+};
+
+export const mockIntegerInputNode: NodeDefinition = {
+  id: 'test/node/integer',
+  inputs: { value: { type: 'integer' } },
+  outputs: [],
+  meta: { title: 'Integer Input' },
+  execute: () => new Int32Array()
+};
+
+export const mockBooleanOutputNode: NodeDefinition = {
+  id: 'test/node/boolean',
+  inputs: {},
+  outputs: ['boolean'],
+  meta: { title: 'Boolean Output' },
+  execute: () => new Int32Array()
+};
+
+export const mockBooleanInputNode: NodeDefinition = {
+  id: 'test/node/boolean-input',
+  inputs: { value: { type: 'boolean' } },
+  outputs: [],
+  meta: { title: 'Boolean Input' },
+  execute: () => new Int32Array()
+};
--- a/app/src/lib/graph-templates.test.ts
+++ b/app/src/lib/graph-templates.test.ts
@@ -0,0 +1,110 @@
+import { grid } from '$lib/graph-templates/grid';
+import { tree } from '$lib/graph-templates/tree';
+import { describe, expect, it } from 'vitest';
+
+describe('graph-templates', () => {
+  describe('grid', () => {
+    it('should create a grid graph with nodes and edges', () => {
+      const result = grid(2, 3);
+      expect(result.nodes.length).toBeGreaterThan(0);
+      expect(result.edges.length).toBeGreaterThan(0);
+    });
+
+    it('should have output node at the end', () => {
+      const result = grid(1, 1);
+      const outputNode = result.nodes.find(n => n.type === 'max/plantarium/output');
+      expect(outputNode).toBeDefined();
+    });
+
+    it('should create nodes based on grid dimensions', () => {
+      const result = grid(2, 2);
+      const mathNodes = result.nodes.filter(n => n.type === 'max/plantarium/math');
+      expect(mathNodes.length).toBeGreaterThan(0);
+      const outputNode = result.nodes.find(n => n.type === 'max/plantarium/output');
+      expect(outputNode).toBeDefined();
+    });
+
+    it('should have output node at the end', () => {
+      const result = grid(1, 1);
+      const outputNode = result.nodes.find(n => n.type === 'max/plantarium/output');
+      expect(outputNode).toBeDefined();
+    });
+
+    it('should create nodes based on grid dimensions', () => {
+      const result = grid(2, 2);
+      const mathNodes = result.nodes.filter(n => n.type === 'max/plantarium/math');
+      expect(mathNodes.length).toBeGreaterThan(0);
+      const outputNode = result.nodes.find(n => n.type === 'max/plantarium/output');
+      expect(outputNode).toBeDefined();
+    });
+
+    it('should have valid node positions', () => {
+      const result = grid(3, 2);
+
+      result.nodes.forEach(node => {
+        expect(node.position).toHaveLength(2);
+        expect(typeof node.position[0]).toBe('number');
+        expect(typeof node.position[1]).toBe('number');
+      });
+    });
+
+    it('should generate valid graph structure', () => {
+      const result = grid(2, 2);
+
+      result.nodes.forEach(node => {
+        expect(typeof node.id).toBe('number');
+        expect(node.type).toBeTruthy();
+      });
+
+      result.edges.forEach(edge => {
+        expect(edge).toHaveLength(4);
+      });
+    });
+  });
+
+  describe('tree', () => {
+    it('should create a tree graph with specified depth', () => {
+      const result = tree(0);
+
+      expect(result.nodes.length).toBeGreaterThan(0);
+      expect(result.edges.length).toBeGreaterThan(0);
+    });
+
+    it('should have root output node', () => {
+      const result = tree(2);
+
+      const outputNode = result.nodes.find(n => n.type === 'max/plantarium/output');
+      expect(outputNode).toBeDefined();
+      expect(outputNode?.id).toBe(0);
+    });
+
+    it('should increase node count with depth', () => {
+      const tree0 = tree(0);
+      const tree1 = tree(1);
+      const tree2 = tree(2);
+
+      expect(tree0.nodes.length).toBeLessThan(tree1.nodes.length);
+      expect(tree1.nodes.length).toBeLessThan(tree2.nodes.length);
+    });
+
+    it('should create binary tree structure', () => {
+      const result = tree(2);
+
+      const mathNodes = result.nodes.filter(n => n.type === 'max/plantarium/math');
+      expect(mathNodes.length).toBeGreaterThan(0);
+
+      const edgeCount = result.edges.length;
+      expect(edgeCount).toBe(result.nodes.length - 1);
+    });
+
+    it('should have valid node positions', () => {
+      const result = tree(3);
+
+      result.nodes.forEach(node => {
+        expect(node.position).toHaveLength(2);
+        expect(typeof node.position[0]).toBe('number');
+        expect(typeof node.position[1]).toBe('number');
+      });
+    });
+  });
+});
--- a/app/src/lib/graph-templates/index.ts
+++ b/app/src/lib/graph-templates/index.ts
@@ -4,4 +4,5 @@ export { default as lottaFaces } from './lotta-faces.json';
 export { default as lottaNodesAndFaces } from './lotta-nodes-and-faces.json';
 export { default as lottaNodes } from './lotta-nodes.json';
 export { plant } from './plant';
+export { default as simple } from './simple.json';
 export { tree } from './tree';
--- a/app/src/lib/graph-templates/simple.json
+++ b/app/src/lib/graph-templates/simple.json
@@ -0,0 +1,63 @@
+{
+  "id": 0,
+  "settings": {
+    "resolution.circle": 54,
+    "resolution.curve": 20,
+    "randomSeed": true
+  },
+  "meta": {
+    "title": "New Project",
+    "lastModified": "2026-02-03T16:56:40.375Z"
+  },
+  "nodes": [
+    {
+      "id": 9,
+      "position": [
+        215,
+        85
+      ],
+      "type": "max/plantarium/output",
+      "props": {}
+    },
+    {
+      "id": 10,
+      "position": [
+        165,
+        72.5
+      ],
+      "type": "max/plantarium/stem",
+      "props": {
+        "amount": 50,
+        "length": 4,
+        "thickness": 1
+      }
+    },
+    {
+      "id": 11,
+      "position": [
+        190,
+        77.5
+      ],
+      "type": "max/plantarium/noise",
+      "props": {
+        "plant": 0,
+        "scale": 0.5,
+        "strength": 5
+      }
+    }
+  ],
+  "edges": [
+    [
+      10,
+      0,
+      11,
+      "plant"
+    ],
+    [
+      11,
+      0,
+      9,
+      "input"
+    ]
+  ]
+}
--- a/app/src/lib/helpers.test.ts
+++ b/app/src/lib/helpers.test.ts
@@ -0,0 +1,145 @@
+import { clone, debounce, humanizeDuration, humanizeNumber, lerp, snapToGrid } from '$lib/helpers';
+import { describe, expect, it } from 'vitest';
+
+describe('helpers', () => {
+  describe('snapToGrid', () => {
+    it('should snap to nearest grid point', () => {
+      expect(snapToGrid(5, 10)).toBe(10);
+      expect(snapToGrid(15, 10)).toBe(20);
+      expect(snapToGrid(0, 10)).toBe(0);
+      expect(snapToGrid(-10, 10)).toBe(-10);
+    });
+
+    it('should snap exact midpoint values', () => {
+      expect(snapToGrid(5, 10)).toBe(10);
+    });
+
+    it('should use default grid size of 10', () => {
+      expect(snapToGrid(5)).toBe(10);
+      expect(snapToGrid(15)).toBe(20);
+    });
+
+    it('should handle values exactly on grid', () => {
+      expect(snapToGrid(10, 10)).toBe(10);
+      expect(snapToGrid(20, 10)).toBe(20);
+    });
+  });
+
+  describe('lerp', () => {
+    it('should linearly interpolate between two values', () => {
+      expect(lerp(0, 100, 0)).toBe(0);
+      expect(lerp(0, 100, 0.5)).toBe(50);
+      expect(lerp(0, 100, 1)).toBe(100);
+    });
+
+    it('should handle negative values', () => {
+      expect(lerp(-50, 50, 0.5)).toBe(0);
+      expect(lerp(-100, 0, 0.5)).toBe(-50);
+    });
+
+    it('should handle t values outside 0-1 range', () => {
+      expect(lerp(0, 100, -0.5)).toBe(-50);
+      expect(lerp(0, 100, 1.5)).toBe(150);
+    });
+  });
+
+  describe('humanizeNumber', () => {
+    it('should return unchanged numbers below 1000', () => {
+      expect(humanizeNumber(0)).toBe('0');
+      expect(humanizeNumber(999)).toBe('999');
+    });
+
+    it('should add K suffix for thousands', () => {
+      expect(humanizeNumber(1000)).toBe('1K');
+      expect(humanizeNumber(1500)).toBe('1.5K');
+      expect(humanizeNumber(999999)).toBe('1000K');
+    });
+
+    it('should add M suffix for millions', () => {
+      expect(humanizeNumber(1000000)).toBe('1M');
+      expect(humanizeNumber(2500000)).toBe('2.5M');
+    });
+
+    it('should add B suffix for billions', () => {
+      expect(humanizeNumber(1000000000)).toBe('1B');
+    });
+  });
+
+  describe('humanizeDuration', () => {
+    it('should return ms for very short durations', () => {
+      expect(humanizeDuration(100)).toBe('100ms');
+      expect(humanizeDuration(999)).toBe('999ms');
+    });
+
+    it('should format seconds', () => {
+      expect(humanizeDuration(1000)).toBe('1s');
+      expect(humanizeDuration(1500)).toBe('1s500ms');
+      expect(humanizeDuration(59000)).toBe('59s');
+    });
+
+    it('should format minutes', () => {
+      expect(humanizeDuration(60000)).toBe('1m');
+      expect(humanizeDuration(90000)).toBe('1m 30s');
+    });
+
+    it('should format hours', () => {
+      expect(humanizeDuration(3600000)).toBe('1h');
+      expect(humanizeDuration(3661000)).toBe('1h 1m 1s');
+    });
+
+    it('should format days', () => {
+      expect(humanizeDuration(86400000)).toBe('1d');
+      expect(humanizeDuration(90061000)).toBe('1d 1h 1m 1s');
+    });
+
+    it('should handle zero', () => {
+      expect(humanizeDuration(0)).toBe('0ms');
+    });
+  });
+
+  describe('debounce', () => {
+    it('should return a function', () => {
+      const fn = debounce(() => {}, 100);
+      expect(typeof fn).toBe('function');
+    });
+
+    it('should only call once when invoked multiple times within delay', () => {
+      let callCount = 0;
+      const fn = debounce(() => {
+        callCount++;
+      }, 100);
+      fn();
+      const firstCall = callCount;
+      fn();
+      fn();
+      expect(callCount).toBe(firstCall);
+    });
+  });
+
+  describe('clone', () => {
+    it('should deep clone objects', () => {
+      const original = { a: 1, b: { c: 2 } };
+      const cloned = clone(original);
+
+      expect(cloned).toEqual(original);
+      expect(cloned).not.toBe(original);
+      expect(cloned.b).not.toBe(original.b);
+    });
+
+    it('should handle arrays', () => {
+      const original = [1, 2, [3, 4]];
+      const cloned = clone(original);
+
+      expect(cloned).toEqual(original);
+      expect(cloned).not.toBe(original);
+      expect(cloned[2]).not.toBe(original[2]);
+    });
+
+    it('should handle primitives', () => {
+      expect(clone(42)).toBe(42);
+      expect(clone('hello')).toBe('hello');
+      expect(clone(true)).toBe(true);
+      expect(clone(null)).toBe(null);
+    });
+  });
+});
--- a/app/src/lib/helpers/deepMerge.test.ts
+++ b/app/src/lib/helpers/deepMerge.test.ts
@@ -0,0 +1,72 @@
+import { isObject, mergeDeep } from '$lib/helpers/deepMerge';
+import { describe, expect, it } from 'vitest';
+
+describe('deepMerge', () => {
+  describe('isObject', () => {
+    it('should return true for plain objects', () => {
+      expect(isObject({})).toBe(true);
+      expect(isObject({ a: 1 })).toBe(true);
+    });
+
+    it('should return false for non-objects', () => {
+      expect(isObject([])).toBe(false);
+      expect(isObject('string')).toBe(false);
+      expect(isObject(42)).toBe(false);
+      expect(isObject(undefined)).toBe(false);
+    });
+  });
+
+  describe('mergeDeep', () => {
+    it('should merge two flat objects', () => {
+      const target = { a: 1, b: 2 };
+      const source = { b: 3, c: 4 };
+      const result = mergeDeep(target, source);
+
+      expect(result).toEqual({ a: 1, b: 3, c: 4 });
+    });
+
+    it('should deeply merge nested objects', () => {
+      const target = { a: { x: 1 }, b: { y: 2 } };
+      const source = { a: { y: 2 }, c: { z: 3 } };
+      const result = mergeDeep(target, source);
+
+      expect(result).toEqual({
+        a: { x: 1, y: 2 },
+        b: { y: 2 },
+        c: { z: 3 }
+      });
+    });
+
+    it('should handle multiple sources', () => {
+      const target = { a: 1 };
+      const source1 = { b: 2 };
+      const source2 = { c: 3 };
+      const result = mergeDeep(target, source1, source2);
+
+      expect(result).toEqual({ a: 1, b: 2, c: 3 });
+    });
+
+    it('should return target if no sources provided', () => {
+      const target = { a: 1 };
+      const result = mergeDeep(target);
+
+      expect(result).toBe(target);
+    });
+
+    it('should overwrite non-object values', () => {
+      const target = { a: { b: 1 } };
+      const source = { a: 'string' };
+      const result = mergeDeep(target, source);
+
+      expect(result.a).toBe('string');
+    });
+
+    it('should handle arrays by replacing', () => {
+      const target = { a: [1, 2] };
+      const source = { a: [3, 4] };
+      const result = mergeDeep(target, source);
+
+      expect(result.a).toEqual([3, 4]);
+    });
+  });
+});
--- a/app/src/lib/performance/Monitor.svelte
+++ b/app/src/lib/performance/Monitor.svelte
@@ -86,7 +86,7 @@
    position: absolute;
  }
  svg {
-    height: 124px;
+    height: 126px;
    margin: 24px 0px;
    border-top: solid thin var(--color-outline);
    border-bottom: solid thin var(--color-outline);
--- a/app/src/lib/project-manager/ProjectManager.svelte
+++ b/app/src/lib/project-manager/ProjectManager.svelte
@@ -1,13 +1,13 @@
 <script lang="ts">
-  import { defaultPlant, lottaFaces, plant } from '$lib/graph-templates';
+  import { defaultPlant, lottaFaces, plant, simple } from '$lib/graph-templates';
  import type { Graph } from '$lib/types';
+  import { InputSelect } from '@nodarium/ui';
  import type { ProjectManager } from './project-manager.svelte';

  const { projectManager } = $props<{ projectManager: ProjectManager }>();

  let showNewProject = $state(false);
  let newProjectName = $state('');
-  let selectedTemplate = $state('defaultPlant');

  const templates = [
    {
@@ -16,25 +16,27 @@
      graph: defaultPlant as unknown as Graph
    },
    { name: 'Plant', value: 'plant', graph: plant as unknown as Graph },
+    { name: 'Simple', value: 'simple', graph: simple as unknown as Graph },
    {
      name: 'Lotta Faces',
      value: 'lottaFaces',
      graph: lottaFaces as unknown as Graph
    }
  ];
+  let selectedTemplateIndex = $state(0);

  function handleCreate() {
-    const template = templates.find((t) => t.value === selectedTemplate) || templates[0];
+    const template = templates[selectedTemplateIndex] || templates[0];
    projectManager.handleCreateProject(template.graph, newProjectName);
    newProjectName = '';
    showNewProject = false;
  }
 </script>

-<header class="flex justify-between px-4 h-[70px] border-b-1 border-outline items-center">
+<header class="flex justify-between px-4 h-[70px] border-b-1 border-outline items-center bg-layer-2">
  <h3>Project</h3>
  <button
-    class="px-3 py-1 bg-layer-0 rounded"
+    class="px-3 py-1 bg-layer-1 rounded"
    onclick={() => (showNewProject = !showNewProject)}
  >
    New
@@ -42,24 +44,17 @@
 </header>

 {#if showNewProject}
-  <div class="flex flex-col px-4 py-3 border-b-1 border-outline gap-2">
+  <div class="flex flex-col px-4 py-3.5 mt-[1px] border-b-1 border-outline gap-3">
    <input
      type="text"
      bind:value={newProjectName}
      placeholder="Project name"
-      class="w-full px-2 py-2 bg-gray-800 border border-gray-700 rounded"
+      class="w-full px-2 py-2 bg-layer-2 rounded"
      onkeydown={(e) => e.key === 'Enter' && handleCreate()}
    />
-    <select
-      bind:value={selectedTemplate}
-      class="w-full px-2 py-2 bg-gray-800 border border-gray-700 rounded"
-    >
-      {#each templates as template (template.name)}
-        <option value={template.value}>{template.name}</option>
-      {/each}
-    </select>
+    <InputSelect options={templates.map(t => t.name)} bind:value={selectedTemplateIndex} />
    <button
-      class="cursor-pointer self-end px-3 py-1 bg-blue-600 rounded"
+      class="cursor-pointer self-end px-3 py-1 bg-selected rounded"
      onclick={() => handleCreate()}
    >
      Create
@@ -67,20 +62,22 @@
  </div>
 {/if}

-<div class="p-4 text-white min-h-screen">
+<div class="text-white min-h-screen">
  {#if projectManager.loading}
    <p>Loading...</p>
  {/if}

-  <ul class="space-y-2">
+  <ul>
    {#each projectManager.projects as project (project.id)}
      <li>
        <div
          class="
-            w-full text-left px-3 py-2 rounded cursor-pointer {projectManager
+            h-[70px] border-b-1 border-b-outline
+            flex
+            w-full text-left px-3 py-2 cursor-pointer {projectManager
            .activeProjectId.value === project.id
-            ? 'bg-blue-600'
-            : 'bg-gray-800 hover:bg-gray-700'}
+            ? 'border-l-2 border-l-selected pl-2.5!'
+            : ''}
          "
          onclick={() => projectManager.handleSelectProject(project.id!)}
          role="button"
@@ -89,10 +86,10 @@
          e.key === 'Enter'
          && projectManager.handleSelectProject(project.id!)}
        >
-          <div class="flex justify-between items-center">
+          <div class="flex justify-between items-center grow">
            <span>{project.meta?.title || 'Untitled'}</span>
            <button
-              class="text-red-400 hover:text-red-300"
+              class="text-layer-1! bg-red-500 w-7 text-xl rounded-sm cursor-pointer opacity-20 hover:opacity-80"
              onclick={() => {
                projectManager.handleDeleteProject(project.id!);
              }}
--- a/app/src/lib/project-manager/project-manager.svelte.ts
+++ b/app/src/lib/project-manager/project-manager.svelte.ts
@@ -54,7 +54,7 @@ export class ProjectManager {

    g.id = id;
    if (!g.meta) g.meta = {};
-    if (!g.meta.title) g.meta.title = title;
+    g.meta.title = title;

    db.saveGraph(g);
    this.projects = [...this.projects, g];
--- a/app/src/lib/settings/NestedSettings.svelte
+++ b/app/src/lib/settings/NestedSettings.svelte
@@ -56,6 +56,10 @@
      return 0;
    }

+    if (Array.isArray(inputValue) && node.type === 'vec3') {
+      return inputValue;
+    }
+
    // If the component is supplied with a default value use that
    if (inputValue !== undefined && typeof inputValue !== 'object') {
      return inputValue;
@@ -98,7 +102,7 @@
      && typeof internalValue === 'number'
    ) {
      value[key] = node?.options?.[internalValue];
-    } else if (internalValue) {
+    } else if (internalValue !== undefined) {
      value[key] = internalValue;
    }
  });
@@ -124,7 +128,6 @@

 {#if key && isNodeInput(type?.[key])}
  {@const inputType = type[key]}
-  <!-- Leaf input -->
  <div class="input input-{inputType.type}" class:first-level={depth === 1}>
    {#if inputType.type === 'button'}
      <button onclick={handleClick}>
@@ -138,7 +141,6 @@
    {/if}
  </div>
 {:else if depth === 0}
-  <!-- Root: iterate over top-level keys -->
  {#each Object.keys(type ?? {}).filter((k) => k !== 'title') as childKey (childKey)}
    <NestedSettings
      id={`${id}.${childKey}`}
@@ -150,7 +152,6 @@
  {/each}
  <hr />
 {:else if key && type?.[key]}
-  <!-- Group -->
  {#if depth > 0}
    <hr />
  {/if}
@@ -210,7 +211,7 @@
  .first-level.input {
    padding-left: 1em;
    padding-right: 1em;
-    padding-bottom: 1px;
+    padding-bottom: 0.5px;
    gap: 3px;
  }

--- a/app/src/lib/sidebar/Panel.svelte
+++ b/app/src/lib/sidebar/Panel.svelte
@@ -34,7 +34,7 @@
  <div class="wrapper" class:hidden>
    {#if title}
      <header class="bg-layer-2">
-        <h3 class="font-bold">{title}</h3>
+        <h3>{title}</h3>
      </header>
    {/if}
    {@render children?.()}
--- a/app/src/lib/sidebar/panels/ActiveNodeSettings.svelte
+++ b/app/src/lib/sidebar/panels/ActiveNodeSettings.svelte
@@ -12,7 +12,7 @@
 </script>

 <div class='{node?"border-l-2 pl-3.5!":""} bg-layer-2 flex items-center h-[70px] border-b-1 border-l-selected border-b-outline pl-4'>
-  <h3 class="font-bold">Node Settings</h3>
+  <h3>Node Settings</h3>
 </div>

 {#if node}
--- a/app/src/lib/sidebar/panels/Changelog.svelte
+++ b/app/src/lib/sidebar/panels/Changelog.svelte
@@ -0,0 +1,185 @@
+<script lang="ts">
+  import { Details } from '@nodarium/ui';
+  import { micromark } from 'micromark';
+
+  type Props = {
+    git?: Record<string, string>;
+    changelog?: string;
+  };
+
+  const {
+    git,
+    changelog
+  }: Props = $props();
+
+  const typeMap = new Map([
+    ['fix', 'border-l-red-800'],
+    ['feat', 'border-l-green-800'],
+    ['chore', 'border-l-gray-800'],
+    ['docs', 'border-l-blue-800'],
+    ['refactor', 'border-l-purple-800'],
+    ['ci', 'border-l-red-400']
+  ]);
+
+  function detectCommitType(commit: string) {
+    for (const key of typeMap.keys()) {
+      if (commit.startsWith(key)) {
+        return key;
+      }
+    }
+    return '';
+  }
+
+  function parseCommit(line?: string) {
+    if (!line) return;
+
+    const regex = /^\s*-\s*\[([a-f0-9]+)\]\((https?:\/\/[^\s)]+)\)\s+(.+)$/;
+
+    const match = line.match(regex);
+    if (!match) {
+      return undefined;
+    }
+
+    const [, sha, link, description] = match;
+
+    return {
+      sha,
+      link,
+      description,
+      type: detectCommitType(description)
+    };
+  }
+
+  function parseChangelog(md: string) {
+    return md.split(/^# v/gm)
+      .filter(l => !!l.length)
+      .map(release => {
+        const [firstLine, ...rest] = release.split('\n');
+        const title = firstLine.trim();
+
+        const blocks = rest
+          .join('\n')
+          .split('---');
+
+        const commits = blocks.length > 1
+          ? blocks
+            .at(-1)
+            ?.split('\n')
+            ?.map(line => parseCommit(line))
+            ?.filter(c => !!c)
+          : [];
+
+        const description = (
+          blocks.length > 1
+            ? blocks
+              .slice(0, -1)
+              .join('\n')
+            : blocks[0]
+        ).trim();
+
+        return {
+          description: micromark(description),
+          title,
+          commits
+        };
+      });
+  }
+</script>
+
+<div id="changelog" class="p-4 font-mono text-text overflow-y-auto max-h-full space-y-5">
+  {#if git}
+    <div class="mb-4 p-3 bg-layer-2 text-xs rounded">
+      <p><strong>Branch:</strong> {git.branch}</p>
+      <p>
+        <strong>Commit:</strong>
+        <a
+          href="https://git.max-richter.dev/max/nodarium/commit/{git.sha}"
+          class="link"
+          target="_blank"
+        >
+          {git.sha.slice(0, 7)}
+        </a>
+        – {git.commit_message}
+      </p>
+      <p>
+        <strong>Commits since last release:</strong>
+        {git.commits_since_last_release}
+      </p>
+      <p>
+        <strong>Timestamp:</strong>
+        {new Date(git.commit_timestamp).toLocaleString()}
+      </p>
+    </div>
+  {/if}
+
+  {#if changelog}
+    {#each parseChangelog(changelog) as release (release)}
+      <Details title={release.title}>
+        <!-- eslint-disable-next-line svelte/no-at-html-tags -->
+        <div id="description" class="pb-5">{@html release.description}</div>
+
+        {#if release?.commits?.length}
+          <Details
+            title="All Commits"
+            class="commits"
+          >
+            {#each release.commits as commit (commit)}
+              <p class="py-1 leading-7 text-xs border-b-1 border-l-1 border-b-outline last:border-b-0 -ml-2 pl-2 {typeMap.get(commit.type)}">
+                <!-- eslint-disable-next-line svelte/no-navigation-without-resolve -->
+                <a href={commit.link} class="link" target="_blank">{commit.sha}</a>
+                {commit.description}
+              </p>
+            {/each}
+          </Details>
+        {/if}
+      </Details>
+    {/each}
+  {/if}
+</div>
+
+<style>
+  @reference "tailwindcss";
+
+  #changelog :global(.commits) {
+    margin-left: -16px;
+    margin-right: -16px;
+    border-radius: 0px 0px 2px 2px !important;
+  }
+
+  #changelog :global(details > div){
+    padding-bottom: 0px;
+  }
+
+  #changelog :global(.commits > div) {
+    padding-bottom: 0px;
+    padding-top: 0px;
+  }
+
+  #description :global(h2) {
+    @apply font-bold mt-4 mb-1;
+  }
+  #description :global(h2:first-child) {
+    margin-top: 0px !important;
+  }
+
+  #description :global(ul) {
+    padding-left: 1em;
+  }
+  #description :global(li),
+  #description :global(p) {
+    @apply text-xs!;
+    list-style-type: disc;
+  }
+
+  #changelog :global(details > details[open] > summary){
+    margin-bottom: 20px !important;
+  }
+
+  .link {
+    color: #60a5fa;
+    text-decoration: none;
+  }
+  .link:hover {
+    text-decoration: underline;
+  }
+</style>
--- a/app/src/lib/sidebar/panels/GraphSource.svelte
+++ b/app/src/lib/sidebar/panels/GraphSource.svelte
@@ -7,7 +7,7 @@
    return JSON.stringify(
      {
        ...g,
-        nodes: g.nodes.map((n: object) => ({ ...n, tmp: undefined }))
+        nodes: g.nodes.map((n: object) => ({ ...n, tmp: undefined, state: undefined }))
      },
      null,
      2
--- a/app/src/routes/+layout.server.ts
+++ b/app/src/routes/+layout.server.ts
@@ -1 +1,28 @@
 export const prerender = true;
+
+export async function load({ fetch }) {
+  async function fetchChangelog() {
+    try {
+      const res = await fetch('/CHANGELOG.md');
+      return await res.text();
+    } catch (error) {
+      console.log('Failed to fetch CHANGELOG.md', error);
+      return;
+    }
+  }
+
+  async function fetchGitInfo() {
+    try {
+      const res = await fetch('/git.json');
+      return await res.json();
+    } catch (error) {
+      console.log('Failed to fetch git.json', error);
+      return;
+    }
+  }
+
+  return {
+    git: await fetchGitInfo(),
+    changelog: await fetchChangelog()
+  };
+}
--- a/app/src/routes/+page.svelte
+++ b/app/src/routes/+page.svelte
@@ -17,6 +17,7 @@
  import Panel from '$lib/sidebar/Panel.svelte';
  import ActiveNodeSettings from '$lib/sidebar/panels/ActiveNodeSettings.svelte';
  import BenchmarkPanel from '$lib/sidebar/panels/BenchmarkPanel.svelte';
+  import Changelog from '$lib/sidebar/panels/Changelog.svelte';
  import ExportSettings from '$lib/sidebar/panels/ExportSettings.svelte';
  import GraphSource from '$lib/sidebar/panels/GraphSource.svelte';
  import Keymap from '$lib/sidebar/panels/Keymap.svelte';
@@ -28,6 +29,8 @@

  let performanceStore = createPerformanceStore();

+  const { data } = $props();
+
  const registryCache = new IndexDBCache('node-registry');
  const nodeRegistry = new RemoteNodeRegistry('', registryCache);
  const workerRuntime = new WorkerRuntimeExecutor();
@@ -249,6 +252,13 @@
          />
          <ActiveNodeSettings {manager} bind:node={activeNode} />
        </Panel>
+        <Panel
+          id="changelog"
+          title="Changelog"
+          icon="i-[tabler--file-text-spark] bg-green-400"
+        >
+          <Changelog git={data.git} changelog={data.changelog} />
+        </Panel>
      </Sidebar>
    </Grid.Cell>
  </Grid.Row>
--- a/app/src/routes/dev/+page.svelte
+++ b/app/src/routes/dev/+page.svelte
@@ -7,7 +7,6 @@
  import Sidebar from '$lib/sidebar/Sidebar.svelte';
  import { type NodeId, type NodeInstance } from '@nodarium/types';
  import { concatEncodedArrays, createWasmWrapper, encodeNestedArray } from '@nodarium/utils';
-  import Code from './Code.svelte';

  const registryCache = new IndexDBCache('node-registry');
  const nodeRegistry = new RemoteNodeRegistry('', registryCache);
@@ -78,11 +77,7 @@
  </Grid.Cell>

  <Grid.Cell>
-    <div class="h-screen w-[80vw] overflow-y-auto">
-      {#if nodeWasm}
-        <Code wasm={nodeWasm} />
-      {/if}
-    </div>
+    <div class="h-screen w-[80vw] overflow-y-auto"></div>
  </Grid.Cell>
 </Grid.Row>

--- a/app/src/routes/dev/Code.svelte
+++ b/app/src/routes/dev/Code.svelte
@@ -1,26 +0,0 @@
-<script lang="ts">
-  import wabtInit from 'wabt';
-
-  const { wasm } = $props<{ wasm: ArrayBuffer }>();
-
-  async function toWat(arrayBuffer: ArrayBuffer) {
-    const wabt = await wabtInit();
-
-    const module = wabt.readWasm(new Uint8Array(arrayBuffer), {
-      readDebugNames: true
-    });
-
-    module.generateNames();
-    module.applyNames();
-
-    return module.toText({ foldExprs: false, inlineExport: false });
-  }
-</script>
-
-{#await toWat(wasm)}
-  <p>Converting to WAT</p>
-{:then c}
-  <pre>
-    <code class="text-gray-50">{c}</code>
-  </pre>
-{/await}
--- a/app/static/.gitignore
+++ b/app/static/.gitignore
@@ -1 +1,3 @@
 nodes/
+CHANGELOG.md
+git.json
--- a/app/vite.config.ts
+++ b/app/vite.config.ts
@@ -1,9 +1,10 @@
 import { sveltekit } from '@sveltejs/kit/vite';
 import tailwindcss from '@tailwindcss/vite';
-import { defineConfig } from 'vite';
+import { playwright } from '@vitest/browser-playwright';
 import comlink from 'vite-plugin-comlink';
 import glsl from 'vite-plugin-glsl';
 import wasm from 'vite-plugin-wasm';
+import { defineConfig } from 'vitest/config';

 export default defineConfig({
  plugins: [
@@ -20,5 +21,36 @@ export default defineConfig({
  },
  ssr: {
    noExternal: ['three']
+  },
+  build: {
+    chunkSizeWarningLimit: 2000
+  },
+  test: {
+    expect: { requireAssertions: true },
+    projects: [
+      {
+        extends: './vite.config.ts',
+        test: {
+          name: 'client',
+          browser: {
+            enabled: true,
+            provider: playwright(),
+            instances: [{ browser: 'firefox', headless: true }]
+          },
+          include: ['src/**/*.svelte.{test,spec}.{js,ts}'],
+          exclude: ['src/lib/server/**']
+        }
+      },
+
+      {
+        extends: './vite.config.ts',
+        test: {
+          name: 'server',
+          environment: 'node',
+          include: ['src/**/*.{test,spec}.{js,ts}'],
+          exclude: ['src/**/*.svelte.{test,spec}.{js,ts}']
+        }
+      }
+    ]
  }
 });
--- a/nodes/max/plantarium/shape/.gitignore
+++ b/nodes/max/plantarium/shape/.gitignore
@@ -0,0 +1,6 @@
+/target
+**/*.rs.bk
+Cargo.lock
+bin/
+pkg/
+wasm-pack.log
--- a/nodes/max/plantarium/shape/Cargo.toml
+++ b/nodes/max/plantarium/shape/Cargo.toml
@@ -0,0 +1,12 @@
+[package]
+name = "shape"
+version = "0.1.0"
+authors = ["Max Richter <jim-x@web.de>"]
+edition = "2018"
+
+[lib]
+crate-type = ["cdylib", "rlib"]
+
+[dependencies]
+nodarium_macros = { version = "0.1.0", path = "../../../../packages/macros" }
+nodarium_utils = { version = "0.1.0", path = "../../../../packages/utils" }
--- a/nodes/max/plantarium/shape/src/input.json
+++ b/nodes/max/plantarium/shape/src/input.json
@@ -0,0 +1,27 @@
+{
+  "id": "max/plantarium/shape",
+  "outputs": [
+    "shape"
+  ],
+  "inputs": {
+    "shape": {
+      "type": "shape",
+      "internal": true,
+      "value": [
+        47.8,
+        100,
+        47.8,
+        82.8,
+        30.9,
+        69.1,
+        23.2,
+        40.7,
+        27.1,
+        14.5,
+        42.5,
+        0
+      ],
+      "label": ""
+    }
+  }
+}
--- a/nodes/max/plantarium/shape/src/lib.rs
+++ b/nodes/max/plantarium/shape/src/lib.rs
@@ -0,0 +1,13 @@
+use nodarium_macros::nodarium_definition_file;
+use nodarium_macros::nodarium_execute;
+use nodarium_utils::{concat_args, log, split_args};
+
+nodarium_definition_file!("src/input.json");
+
+#[nodarium_execute]
+pub fn execute(input: &[i32]) -> Vec<i32> {
+    let args = split_args(input);
+    log!("vec3 input: {:?}", input);
+    log!("vec3 args: {:?}", args);
+    concat_args(args)
+}
--- a/package.json
+++ b/package.json
@@ -1,15 +1,15 @@
 {
+  "version": "0.0.3",
  "scripts": {
    "postinstall": "pnpm run -r --filter 'ui' build",
-    "build": "pnpm build:nodes && pnpm build:app",
    "lint": "pnpm run -r --parallel lint",
    "format": "pnpm dprint fmt",
    "format:check": "pnpm dprint check",
+    "test": "pnpm run -r test",
    "check": "pnpm run -r check",
-    "build:story": "pnpm -r --filter 'ui' story:build",
+    "build": "pnpm build:nodes && pnpm build:app",
    "build:app": "BASE_PATH=/ui pnpm -r --filter 'ui' build && pnpm -r --filter 'app' build",
    "build:nodes": "cargo build --workspace --target wasm32-unknown-unknown --release && rm -rf ./app/static/nodes/max/plantarium/ && mkdir -p ./app/static/nodes/max/plantarium/ && cp -R ./target/wasm32-unknown-unknown/release/*.wasm ./app/static/nodes/max/plantarium/",
-    "build:deploy": "pnpm build && cp -R packages/ui/build app/build/ui",
    "dev:nodes": "chokidar './nodes/**' --initial -i '/pkg/' -c 'pnpm build:nodes'",
    "dev:app_ui": "pnpm -r --parallel --filter 'app' --filter './packages/ui' dev",
    "dev_ui": "pnpm -r --filter 'ui' dev:ui",
--- a/packages/types/package.json
+++ b/packages/types/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@nodarium/types",
-  "version": "0.0.0",
+  "version": "0.0.3",
  "description": "",
  "main": "src/index.ts",
  "scripts": {
@@ -17,7 +17,7 @@
  "author": "",
  "license": "ISC",
  "dependencies": {
-    "zod": "^4.3.5"
+    "zod": "^4.3.6"
  },
  "devDependencies": {
    "dprint": "^0.51.1"
--- a/packages/types/src/inputs.ts
+++ b/packages/types/src/inputs.ts
@@ -26,7 +26,6 @@ const DefaultOptionsSchema = z.object({
 export const NodeInputFloatSchema = z.object({
  ...DefaultOptionsSchema.shape,
  type: z.literal('float'),
-  element: z.literal('slider').optional(),
  value: z.number().optional(),
  min: z.number().optional(),
  max: z.number().optional(),
@@ -36,12 +35,17 @@ export const NodeInputFloatSchema = z.object({
 export const NodeInputIntegerSchema = z.object({
  ...DefaultOptionsSchema.shape,
  type: z.literal('integer'),
-  element: z.literal('slider').optional(),
  value: z.number().optional(),
  min: z.number().optional(),
  max: z.number().optional()
 });

+export const NodeInputShapeSchema = z.object({
+  ...DefaultOptionsSchema.shape,
+  type: z.literal('shape'),
+  value: z.array(z.number()).optional()
+});
+
 export const NodeInputBooleanSchema = z.object({
  ...DefaultOptionsSchema.shape,
  type: z.literal('boolean'),
@@ -84,6 +88,7 @@ export const NodeInputSchema = z.union([
  NodeInputBooleanSchema,
  NodeInputFloatSchema,
  NodeInputIntegerSchema,
+  NodeInputShapeSchema,
  NodeInputSelectSchema,
  NodeInputSeedSchema,
  NodeInputVec3Schema,
--- a/packages/types/src/lib.rs
+++ b/packages/types/src/lib.rs
@@ -103,6 +103,15 @@ pub struct NodeInputVec3 {
    pub value: Option<Vec<f64>>,
 }

+#[derive(Serialize, Deserialize)]
+pub struct NodeInputShape {
+    #[serde(flatten)]
+    pub default_options: DefaultOptions,
+
+    #[serde(skip_serializing_if = "Option::is_none")]
+    pub value: Option<Vec<f64>>,
+}
+
 #[derive(Serialize, Deserialize)]
 pub struct NodeInputGeometry {
    #[serde(flatten)]
@@ -125,6 +134,7 @@ pub enum NodeInput {
    select(NodeInputSelect),
    seed(NodeInputSeed),
    vec3(NodeInputVec3),
+    shape(NodeInputShape),
    geometry(NodeInputGeometry),
    path(NodeInputPath),
 }
--- a/packages/ui/package.json
+++ b/packages/ui/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@nodarium/ui",
-  "version": "0.0.1",
+  "version": "0.0.3",
  "scripts": {
    "dev": "vite",
    "build": "vite build && npm run package",
@@ -33,28 +33,32 @@
    "@eslint/compat": "^2.0.2",
    "@eslint/eslintrc": "^3.3.3",
    "@eslint/js": "^9.39.2",
-    "@nodarium/types": "workspace:",
+    "@nodarium/types": "workspace:^",
+    "@playwright/test": "^1.58.1",
    "@sveltejs/adapter-static": "^3.0.10",
-    "@sveltejs/kit": "^2.50.0",
+    "@sveltejs/kit": "^2.50.2",
    "@sveltejs/package": "^2.5.7",
    "@sveltejs/vite-plugin-svelte": "^6.2.4",
+    "@testing-library/svelte": "^5.3.1",
    "@types/eslint": "^9.6.1",
    "@types/three": "^0.182.0",
-    "@typescript-eslint/eslint-plugin": "^8.53.0",
-    "@typescript-eslint/parser": "^8.53.0",
+    "@typescript-eslint/eslint-plugin": "^8.54.0",
+    "@typescript-eslint/parser": "^8.54.0",
+    "@vitest/browser-playwright": "^4.0.18",
    "dprint": "^0.51.1",
    "eslint": "^9.39.2",
    "eslint-plugin-svelte": "^3.14.0",
    "globals": "^17.3.0",
-    "publint": "^0.3.16",
-    "svelte": "^5.46.4",
-    "svelte-check": "^4.3.5",
+    "publint": "^0.3.17",
+    "svelte": "^5.49.2",
+    "svelte-check": "^4.3.6",
    "svelte-eslint-parser": "^1.4.1",
    "tslib": "^2.8.1",
    "typescript": "^5.9.3",
    "typescript-eslint": "^8.54.0",
    "vite": "^7.3.1",
-    "vitest": "^4.0.17"
+    "vitest": "^4.0.18",
+    "vitest-browser-svelte": "^2.0.2"
  },
  "svelte": "./dist/index.js",
  "types": "./dist/index.d.ts",
--- a/packages/ui/src/lib/Details.svelte
+++ b/packages/ui/src/lib/Details.svelte
@@ -1,31 +1,46 @@
 <script lang="ts">
-  import type { Snippet } from 'svelte';
+  import { type Snippet } from 'svelte';
  interface Props {
    title?: string;
    transparent?: boolean;
    children?: Snippet;
    open?: boolean;
+    class?: string;
  }
-  let { title = 'Details', transparent = false, children, open = $bindable(false) }: Props =
-    $props();
+  let { title = 'Details', transparent = false, children, open = $bindable(false), class: _class }:
+    Props = $props();
 </script>

-<details class:transparent bind:open class="text-text outline-1 outline-outline bg-layer-1">
+<details
+  class:transparent
+  bind:open
+  class="text-text outline-1 outline-outline bg-layer-1 {_class}"
+>
  <summary>{title}</summary>
-  <div class="content">
+  <div>
    {@render children?.()}
  </div>
 </details>

 <style>
  details {
+    border-radius: 2px;
+  }
+  summary {
    padding: 1em;
    padding-left: 20px;
-    border-radius: 2px;
    font-weight: 300;
    font-size: 0.9em;
  }

+  details[open] > summary {
+    border-bottom: solid thin var(--color-outline);
+  }
+
+  details > div {
+    padding: 1em;
+  }
+
  details.transparent {
    background-color: transparent;
    padding: 0;
--- a/packages/ui/src/lib/Details.svelte.ts
+++ b/packages/ui/src/lib/Details.svelte.ts
@@ -0,0 +1,13 @@
+import { describe, expect, it } from 'vitest';
+import { render } from 'vitest-browser-svelte';
+import { page } from 'vitest/browser';
+import Details from './Details.svelte';
+
+describe('Details', () => {
+  it('should render summary element', async () => {
+    render(Details, { title: 'Click me' });
+
+    const summary = page.getByText('Click me');
+    await expect.element(summary).toBeInTheDocument();
+  });
+});
--- a/packages/ui/src/lib/Input.svelte
+++ b/packages/ui/src/lib/Input.svelte
@@ -1,7 +1,7 @@
 <script lang="ts">
  import type { NodeInput } from '@nodarium/types';

-  import { InputCheckbox, InputNumber, InputSelect, InputVec3 } from './index';
+  import { InputCheckbox, InputNumber, InputSelect, InputShape, InputVec3 } from './index';

  interface Props {
    input: NodeInput;
@@ -19,6 +19,8 @@
    max={input?.max}
    step={input?.step}
  />
+{:else if input.type === 'shape'}
+  <InputShape bind:value={value as number[]} />
 {:else if input.type === 'integer'}
  <InputNumber bind:value={value as number} min={input?.min} max={input?.max} step={1} />
 {:else if input.type === 'boolean'}
--- a/packages/ui/src/lib/ShortCut.svelte.ts
+++ b/packages/ui/src/lib/ShortCut.svelte.ts
@@ -0,0 +1,34 @@
+import { describe, expect, it } from 'vitest';
+import { render } from 'vitest-browser-svelte';
+import { page } from 'vitest/browser';
+import ShortCut from './ShortCut.svelte';
+
+describe('ShortCut', () => {
+  it('should render with key label', async () => {
+    render(ShortCut, { key: 'S' });
+
+    const shortcut = page.getByText('S');
+    await expect.element(shortcut).toBeInTheDocument();
+  });
+
+  it('should render ctrl modifier', async () => {
+    render(ShortCut, { ctrl: true, key: 'S' });
+
+    const shortcut = page.getByText(/Ctrl/);
+    await expect.element(shortcut).toBeInTheDocument();
+  });
+
+  it('should render alt modifier', async () => {
+    render(ShortCut, { alt: true, key: 'F4' });
+
+    const shortcut = page.getByText(/Alt/);
+    await expect.element(shortcut).toBeInTheDocument();
+  });
+
+  it('should render multiple modifiers', async () => {
+    render(ShortCut, { ctrl: true, alt: true, key: 'Delete' });
+
+    const shortcut = page.getByText(/Ctrl/);
+    await expect.element(shortcut).toBeInTheDocument();
+  });
+});
--- a/packages/ui/src/lib/app.css
+++ b/packages/ui/src/lib/app.css
@@ -11,7 +11,6 @@
@source inline("{hover:,}{bg-,outline-,text-,}selected");
@source inline("{hover:,}{bg-,outline-,text-,}outline{!,}");
@source inline("{hover:,}{bg-,outline-,text-,}connection");
-@source inline("{hover:,}{bg-,outline-,text-,}edge");
@source inline("{hover:,}{bg-,outline-,text-,}text");

 /* fira-code-300 - latin */
@@ -72,12 +71,12 @@

  --color-outline: var(--neutral-400);
  --color-connection: #333333;
-  --color-edge: var(--connection, var(--color-outline));

  --color-text: var(--neutral-200);
 }

 html {
+  --neutral-050: #f0f0f0;
  --neutral-100: #e7e7e7;
  --neutral-200: #cecece;
  --neutral-300: #7c7c7c;
@@ -89,14 +88,13 @@ html {
  --color-layer-0: var(--neutral-900);
  --color-layer-1: var(--neutral-500);
  --color-layer-2: var(--neutral-400);
-  --color-layer-3: var(--neutral-200);
+  --color-layer-3: var(--neutral-300);

  --color-active: #ffffff;
  --color-selected: #c65a19;

-  --color-outline: var(--neutral-400);
+  --color-outline: #3e3e3e;
  --color-connection: #333333;
-  --color-edge: var(--connection, var(--color-outline));

  --color-text-color: var(--neutral-200);
 }
@@ -110,10 +108,10 @@ body {
 html.theme-light {
  --color-text: var(--neutral-800);
  --color-outline: var(--neutral-300);
-  --color-layer-0: var(--neutral-100);
+  --color-layer-0: var(--neutral-050);
  --color-layer-1: var(--neutral-100);
  --color-layer-2: var(--neutral-200);
-  --color-layer-3: var(--neutral-500);
+  --color-layer-3: var(--neutral-300);
  --color-active: #000000;
  --color-selected: #c65a19;
  --color-connection: #888;
--- a/packages/ui/src/lib/helpers/getBoundingValue.test.ts
+++ b/packages/ui/src/lib/helpers/getBoundingValue.test.ts
@@ -0,0 +1,55 @@
+import { describe, expect, it } from 'vitest';
+import { getBoundingValue } from './getBoundingValue';
+
+describe('getBoundingValue', () => {
+  it('should return 1 for values between 0 and 1', () => {
+    expect(getBoundingValue(0)).toBe(1);
+    expect(getBoundingValue(0.5)).toBe(1);
+    expect(getBoundingValue(1)).toBe(1);
+  });
+
+  it('should return 2 for values between 1 and 2', () => {
+    expect(getBoundingValue(1.1)).toBe(2);
+    expect(getBoundingValue(1.5)).toBe(2);
+    expect(getBoundingValue(2)).toBe(2);
+  });
+
+  it('should return 4 for values between 2 and 4', () => {
+    expect(getBoundingValue(2.1)).toBe(4);
+    expect(getBoundingValue(3)).toBe(4);
+    expect(getBoundingValue(4)).toBe(4);
+  });
+
+  it('should return positive level for positive input', () => {
+    expect(getBoundingValue(5)).toBe(10);
+    expect(getBoundingValue(15)).toBe(20);
+    expect(getBoundingValue(50)).toBe(50);
+    expect(getBoundingValue(150)).toBe(200);
+  });
+
+  it('should return negative level for negative input', () => {
+    expect(getBoundingValue(-5)).toBe(-10);
+    expect(getBoundingValue(-15)).toBe(-20);
+    expect(getBoundingValue(-50)).toBe(-50);
+    expect(getBoundingValue(-150)).toBe(-200);
+  });
+
+  it('should return correct level for boundary values', () => {
+    expect(getBoundingValue(10)).toBe(10);
+    expect(getBoundingValue(20)).toBe(20);
+    expect(getBoundingValue(50)).toBe(50);
+    expect(getBoundingValue(100)).toBe(100);
+    expect(getBoundingValue(200)).toBe(200);
+  });
+
+  it('should handle large values', () => {
+    expect(getBoundingValue(1000)).toBe(1000);
+    expect(getBoundingValue(1500)).toBe(1000);
+    expect(getBoundingValue(-1000)).toBe(-1000);
+  });
+
+  it('should handle very small values', () => {
+    expect(getBoundingValue(0.001)).toBe(1);
+    expect(getBoundingValue(-0.001)).toBe(-1);
+  });
+});
--- a/packages/ui/src/lib/index.ts
+++ b/packages/ui/src/lib/index.ts
@@ -2,6 +2,7 @@ export { default as Input } from './Input.svelte';
 export { default as InputCheckbox } from './inputs/InputCheckbox.svelte';
 export { default as InputNumber } from './inputs/InputNumber.svelte';
 export { default as InputSelect } from './inputs/InputSelect.svelte';
+export { default as InputShape } from './inputs/InputShape.svelte';
 export { default as InputVec3 } from './inputs/InputVec3.svelte';

 export { default as Details } from './Details.svelte';
--- a/packages/ui/src/lib/inputs/InputCheckbox.svelte
+++ b/packages/ui/src/lib/inputs/InputCheckbox.svelte
@@ -27,7 +27,7 @@
    {id}
  />
  <span
-    class="absolute opacity-0 peer-checked:opacity-100 transition-opacity duration-100 flex w-full h-full items-center justify-center"
+    class="absolute opacity-0 peer-checked:opacity-100 transition-opacity duration-50 flex w-full h-full items-center justify-center"
  >
    <svg
      viewBox="0 0 19 14"
--- a/packages/ui/src/lib/inputs/InputCheckbox.svelte.ts
+++ b/packages/ui/src/lib/inputs/InputCheckbox.svelte.ts
@@ -0,0 +1,27 @@
+import { describe, expect, it } from 'vitest';
+import { render } from 'vitest-browser-svelte';
+import { page } from 'vitest/browser';
+import InputCheckbox from './InputCheckbox.svelte';
+
+describe('InputCheckbox', () => {
+  it('should render checkbox label', async () => {
+    render(InputCheckbox, { value: false });
+
+    const checkbox = page.getByRole('checkbox');
+    await expect.element(checkbox).toBeInTheDocument();
+  });
+
+  it('should be unchecked when value is false', async () => {
+    render(InputCheckbox, { value: false });
+
+    const input = page.getByRole('checkbox');
+    await expect.element(input).not.toBeChecked();
+  });
+
+  it('should be checked when value is true', async () => {
+    render(InputCheckbox, { value: true });
+
+    const input = page.getByRole('checkbox');
+    await expect.element(input).toBeChecked();
+  });
+});
--- a/packages/ui/src/lib/inputs/InputNumber.svelte
+++ b/packages/ui/src/lib/inputs/InputNumber.svelte
@@ -19,7 +19,6 @@

  // normalize bounds
  if (min > max) [min, max] = [max, min];
-  if (value > max) max = value;

  let inputEl: HTMLInputElement | undefined = $state();

@@ -27,11 +26,18 @@
    return Math.min(max, Math.max(min, v));
  }

-  function snap(v: number) {
-    if (step) v = Math.round(v / step) * step;
+  function snap(v: number, s = step) {
+    if (s) v = Math.round(v / s) * s;
    return +v.toFixed(3);
  }

+  function getAutoStep(v: number): number {
+    const abs = Math.abs(v);
+    if (abs === 0) return 0.1; // fallback for 0
+    const exponent = Math.floor(Math.log10(abs));
+    return Math.pow(10, exponent);
+  }
+
  let dragging = $state(false);
  let startValue = 0;
  let rect: DOMRect;
@@ -59,7 +65,8 @@
    value = snap(
      e.ctrlKey
        ? startValue + delta
-        : clamp(startValue + delta)
+        : clamp(startValue + delta),
+      (e.altKey && !step) ? getAutoStep(value) : step
    );
  }

@@ -105,7 +112,7 @@
  }

  onMount(() => {
-    value = snap(clamp(value));
+    value = snap(value);
  });
 </script>

@@ -130,7 +137,7 @@
    <div
      class="absolute inset-y-0 left-0 bg-layer-3 opacity-30 pointer-events-none transition-[width]"
      class:transition-none={dragging}
-      style={`width: ${Math.min((value - min) / (max - min), 1) * 100}%`}
+      style={`width: ${Math.max(0, Math.min((value - min) / (max - min), 1) * 100)}%`}
    >
    </div>

--- a/packages/ui/src/lib/inputs/InputNumber.svelte.ts
+++ b/packages/ui/src/lib/inputs/InputNumber.svelte.ts
@@ -0,0 +1,59 @@
+import { describe, expect, it } from 'vitest';
+import { render } from 'vitest-browser-svelte';
+import { page } from 'vitest/browser';
+import InputNumber from './InputNumber.svelte';
+
+describe('InputNumber', () => {
+  it('should render input element', async () => {
+    render(InputNumber, { value: 0.5 });
+
+    const input = page.getByRole('spinbutton');
+    await expect.element(input).toBeInTheDocument();
+  });
+
+  it('should render with step buttons when step is provided', async () => {
+    render(InputNumber, { value: 0.5, step: 0.1 });
+
+    const decrementBtn = page.getByRole('button', { name: 'step down' });
+    const incrementBtn = page.getByRole('button', { name: 'step up' });
+    await expect.element(decrementBtn).toBeInTheDocument();
+    await expect.element(incrementBtn).toBeInTheDocument();
+  });
+
+  it('should not render step buttons when step is undefined', async () => {
+    const screen = render(InputNumber, { value: 0.5 });
+
+    const buttons = screen.locator.getByRole('button');
+    const count = buttons.all().length;
+    expect(count).toBe(0);
+  });
+
+  it('should accept numeric value', async () => {
+    render(InputNumber, { value: 42 });
+
+    const input = page.getByRole('spinbutton');
+    await expect.element(input).toHaveValue(42);
+  });
+
+  it('should accept min and max bounds', async () => {
+    render(InputNumber, { value: 5, min: 0, max: 10 });
+
+    const input = page.getByRole('spinbutton');
+    await expect.element(input).toHaveAttribute('min', '0');
+    await expect.element(input).toHaveAttribute('max', '10');
+  });
+
+  it('should not clamp value on init when value exceeds min/max', async () => {
+    render(InputNumber, { value: 100, min: 0, max: 10 });
+
+    const input = page.getByRole('spinbutton');
+    await expect.element(input).toHaveValue(100);
+  });
+
+  it('should not clamp value on init when value is below min', async () => {
+    render(InputNumber, { value: -50, min: 0, max: 10 });
+
+    const input = page.getByRole('spinbutton');
+    await expect.element(input).toHaveValue(-50);
+  });
+});
--- a/packages/ui/src/lib/inputs/InputSelect.svelte
+++ b/packages/ui/src/lib/inputs/InputSelect.svelte
@@ -18,7 +18,7 @@
  select {
    font-family: var(--font-family);
    outline: solid 1px var(--color-outline);
-    padding: 0.8em 1em;
+    padding: 0.5em 0.8em;
    border-radius: 5px;
    border: none;
  }
--- a/packages/ui/src/lib/inputs/InputSelect.svelte.ts
+++ b/packages/ui/src/lib/inputs/InputSelect.svelte.ts
@@ -0,0 +1,27 @@
+import { describe, expect, it } from 'vitest';
+import { render } from 'vitest-browser-svelte';
+import { page } from 'vitest/browser';
+import InputSelect from './InputSelect.svelte';
+
+describe('InputSelect', () => {
+  it('should render select element', async () => {
+    render(InputSelect, { options: ['a', 'b', 'c'], value: 0 });
+
+    const select = page.getByRole('combobox');
+    await expect.element(select).toBeInTheDocument();
+  });
+
+  it('should render all options', async () => {
+    render(InputSelect, { options: ['apple', 'banana', 'cherry'], value: 0 });
+
+    const select = page.getByRole('combobox');
+    await expect.element(select).toHaveTextContent('applebananacherry');
+  });
+
+  it('should select correct option by index', async () => {
+    render(InputSelect, { options: ['first', 'second', 'third'], value: 1 });
+
+    const select = page.getByRole('combobox');
+    await expect.element(select).toHaveTextContent('second');
+  });
+});
--- a/packages/ui/src/lib/inputs/InputShape.svelte
+++ b/packages/ui/src/lib/inputs/InputShape.svelte
@@ -0,0 +1,265 @@
+<script lang="ts">
+  type Props = {
+    value: number[];
+    mirror?: boolean;
+  };
+
+  let { value: points = $bindable(), mirror = true }: Props = $props();
+
+  let mouseDown = $state<number[]>();
+  let draggingIndex = $state<number>();
+  let downCirclePosition = $state<number[]>();
+  let svgElement = $state<SVGElement>(null!);
+  let svgRect = $state<DOMRect>(null!);
+  let isMirroredEvent = $state(false);
+
+  const pathD = $derived(calculatePath(points, mirror));
+  const groupedPoints = $derived(group(points));
+
+  function group<T>(arr: T[], size = 2): T[][] {
+    const result = [];
+    for (let i = 0; i < arr.length; i += size) {
+      result.push(arr.slice(i, i + size));
+    }
+    return result;
+  }
+  const dist = (a: [number, number], b: [number, number]) => Math.hypot(a[0] - b[0], a[1] - b[1]);
+  const clamp = (v: number, min: number, max: number) => Math.min(Math.max(v, min), max);
+  const round = (v: number) => Math.floor(v * 10) / 10;
+  const getPt = (i: number) => [points[i * 2], points[i * 2 + 1]] as [number, number];
+
+  $effect(() => {
+    if (!points.length) {
+      points = [47.8, 100, 47.8, 82.8, 30.9, 69.1, 23.2, 40.7, 27.1, 14.5, 42.5, 0];
+    }
+  });
+
+  $effect(() => {
+    if (mirror) {
+      const _points: [number, number, number][] = [];
+      for (let i = 0; i < points.length / 2; i++) {
+        _points.push([...getPt(i), i]);
+      }
+
+      const sortedPoints = _points
+        .sort((a, b) => {
+          if (a[1] !== b[1]) return b[1] - a[1];
+          return a[0] - b[0];
+        });
+
+      const newIndices = new Map(sortedPoints.map((p, i) => [p[2], i]));
+
+      const sorted = sortedPoints
+        .map(p => [p[0], p[1]])
+        .flat();
+
+      let sortChanged = false;
+
+      for (let i = 0; i < sorted.length; i++) {
+        if (sorted[i] !== points[i]) {
+          sortChanged = true;
+          break;
+        }
+      }
+
+      if (sortChanged) {
+        points = sorted;
+        draggingIndex = newIndices.get(draggingIndex || 0) || 0;
+      }
+    }
+  });
+
+  function insertBetween(newPt: [number, number]): number {
+    const count = points.length / 2;
+
+    if (count < 2) {
+      points = [...points, ...newPt];
+      return count;
+    }
+
+    let minDist = Infinity;
+    let insertIdx = 0;
+
+    for (let i = 0; i < count - 1; i++) {
+      const a = getPt(i);
+      const b = getPt(i + 1);
+      const d = dist(newPt, a) + dist(newPt, b) - dist(a, b);
+      if (d < minDist) {
+        minDist = d;
+        insertIdx = i + 1;
+      }
+    }
+
+    points.splice(insertIdx * 2, 0, newPt[0], newPt[1]);
+    return insertIdx;
+  }
+
+  function calculatePath(pts: number[], mirror = false): string {
+    if (pts.length === 0) return '';
+
+    const arr = [...pts];
+
+    let d = `M ${arr[0]} ${arr[1]}`;
+    for (let i = 2; i < arr.length; i += 2) {
+      d += ` L ${arr[i]} ${arr[i + 1]}`;
+    }
+
+    if (mirror) {
+      for (let i = arr.length - 2; i >= 0; i -= 2) {
+        const x = 100 - arr[i];
+        d += ` L ${x} ${arr[i + 1]}`;
+      }
+      d += ' Z';
+    }
+
+    return d;
+  }
+
+  function handleMouseMove(ev: MouseEvent) {
+    if (mouseDown === undefined || draggingIndex === undefined || !downCirclePosition) return;
+
+    let vx = (mouseDown[0] - ev.clientX) * (100 / svgRect.width);
+    let vy = (mouseDown[1] - ev.clientY) * (100 / svgRect.height);
+
+    if (ev.shiftKey) {
+      vx /= 10;
+      vy /= 10;
+    }
+
+    let x = downCirclePosition[0] + ((isMirroredEvent ? 1 : -1) * vx);
+    let y = downCirclePosition[1] - vy;
+
+    x = clamp(x, 0, mirror ? 50 : 100);
+    y = clamp(y, 0, 100);
+
+    points[draggingIndex * 2] = round(x);
+    points[draggingIndex * 2 + 1] = round(y);
+  }
+
+  function handleMouseDown(ev: MouseEvent) {
+    ev.preventDefault();
+    isMirroredEvent = false;
+
+    svgRect = svgElement.getBoundingClientRect();
+    mouseDown = [ev.clientX, ev.clientY];
+
+    const indexText = (ev.target as SVGCircleElement).dataset.index;
+
+    const x = ((ev.clientX - svgRect.left) / svgRect.width) * 100;
+    const y = ((ev.clientY - svgRect.top) / svgRect.height) * 100;
+    isMirroredEvent = x > 50;
+
+    if (indexText !== undefined) {
+      draggingIndex = parseInt(indexText);
+      downCirclePosition = getPt(draggingIndex);
+    } else {
+      draggingIndex = undefined;
+
+      const pt = [
+        round(clamp(x, 0, 100)),
+        round(clamp(y, 0, 100))
+      ] as [
+        number,
+        number
+      ];
+      if (isMirroredEvent) {
+        pt[0] = 100 - pt[0];
+      }
+
+      draggingIndex = insertBetween(pt);
+      downCirclePosition = pt;
+    }
+  }
+
+  function handleMouseUp() {
+    mouseDown = undefined;
+    draggingIndex = undefined;
+  }
+
+  function handleContextMenu(ev: MouseEvent) {
+    const indexText = (ev.target as HTMLElement).dataset?.index;
+    if (indexText !== undefined) {
+      ev.preventDefault();
+      ev.stopImmediatePropagation();
+      const index = parseInt(indexText);
+      draggingIndex = undefined;
+      points.splice(index * 2, 2);
+    }
+  }
+</script>
+
+<svelte:window
+  onmousemove={handleMouseMove}
+  onmouseup={handleMouseUp}
+  oncontextmenu={handleContextMenu}
+/>
+
+<div class="wrapper" class:mirrored={mirror}>
+  <!-- svelte-ignore a11y_no_static_element_interactions -->
+  <svg
+    width="100"
+    height="100"
+    viewBox="0 0 100 100"
+    bind:this={svgElement}
+    aria-label="Interactive 2D Shape Editor"
+    onmousedown={handleMouseDown}
+  >
+    <path d={pathD} style:fill="var(--color-layer-3)" style:opacity={0.3} />
+    <path d={pathD} fill="none" stroke="var(--color-layer-3)" />
+    {#if mirror}
+      {#each groupedPoints as p, i (i)}
+        {@const x = 100 - p[0]}
+        {@const y = p[1]}
+        <circle
+          class:active={isMirroredEvent && draggingIndex === i}
+          data-index={i}
+          cx={x}
+          cy={y}
+          r={3}
+        >
+        </circle>
+      {/each}
+    {/if}
+
+    {#each groupedPoints as p, i (i)}
+      <circle
+        class:active={!isMirroredEvent && draggingIndex === i}
+        data-index={i}
+        cx={p[0]}
+        cy={p[1]}
+        r={3}
+      >
+      </circle>
+    {/each}
+  </svg>
+</div>
+
+<style>
+  .wrapper {
+    width: 100%;
+    aspect-ratio: 1;
+    background-color: var(--color-layer-2);
+    padding: 7px;
+    border-radius: 5px;
+    outline: solid thin var(--color-outline);
+  }
+
+  svg {
+    height: 100%;
+    width: 100%;
+    overflow: visible;
+  }
+
+  circle {
+    cursor: pointer;
+    stroke: transparent;
+    transition: fill 0.2s ease;
+    stroke-width: 1px;
+    stroke: var(--color-layer-3); 
+    fill: var(--color-layer-2);
+  }
+  circle.active,
+  circle:hover {
+    fill: var(--color-layer-3);
+  }
+</style>
--- a/packages/ui/src/lib/inputs/InputVec3.svelte.ts
+++ b/packages/ui/src/lib/inputs/InputVec3.svelte.ts
@@ -0,0 +1,26 @@
+import { describe, expect, it } from 'vitest';
+import { render } from 'vitest-browser-svelte';
+import { page } from 'vitest/browser';
+import InputVec3 from './InputVec3.svelte';
+
+describe('InputVec3', () => {
+  it('should render with correct initial values', async () => {
+    const value = $state([1.5, 2.5, 3.5]);
+    render(InputVec3, { value });
+
+    const inputs = page.getByRole('spinbutton');
+    await expect.element(inputs.first()).toBeInTheDocument();
+
+    expect(inputs.nth(0)).toHaveValue(1.5);
+    expect(inputs.nth(1)).toHaveValue(2.5);
+    expect(inputs.nth(2)).toHaveValue(3.5);
+  });
+
+  it('should have step attribute', async () => {
+    const value = $state([0, 0, 0]);
+    render(InputVec3, { value });
+
+    const input = page.getByRole('spinbutton').first();
+    await expect.element(input).toHaveAttribute('step', '0.01');
+  });
+});
--- a/packages/ui/src/routes/+page.svelte
+++ b/packages/ui/src/routes/+page.svelte
@@ -1,6 +1,14 @@
 <script lang="ts">
  import '$lib/app.css';
-  import { Details, InputCheckbox, InputNumber, InputSelect, InputVec3, ShortCut } from '$lib';
+  import {
+    Details,
+    InputCheckbox,
+    InputNumber,
+    InputSelect,
+    InputShape,
+    InputVec3,
+    ShortCut
+  } from '$lib';
  import Section from './Section.svelte';

  let intValue = $state(0);
@@ -10,10 +18,12 @@
  const options = ['strawberry', 'raspberry', 'chickpeas'];
  let selectValue = $state(0);
  const d = $derived(options[selectValue]);
-
  let checked = $state(false);
+  let mirrorShape = $state(true);
  let detailsOpen = $state(false);

+  let points = $state([]);
+
  const themes = [
    'dark',
    'light',
@@ -41,7 +51,6 @@
    'selected',
    'outline',
    'connection',
-    'edge',
    'text'
  ];
 </script>
@@ -90,6 +99,19 @@
    <InputCheckbox bind:value={checked} />
  </Section>

+  <Section title="Shape">
+    {#snippet header()}
+      <label class="flex gap-2">
+        <InputCheckbox bind:value={mirrorShape} />
+        <p>mirror</p>
+      </label>
+      <p>{JSON.stringify(points)}</p>
+    {/snippet}
+    <div style:width="300px">
+      <InputShape bind:value={points} mirror={mirrorShape} />
+    </div>
+  </Section>
+
  <Section title="Details" value={detailsOpen}>
    <Details title="More Information" bind:open={detailsOpen}>
      <p>Here is some more information that was previously hidden.</p>
--- a/packages/ui/src/routes/Section.svelte
+++ b/packages/ui/src/routes/Section.svelte
@@ -1,8 +1,9 @@
 <script lang="ts">
  import { type Snippet } from 'svelte';
-  let { title, value, children, class: _class } = $props<{
+  let { title, value, header, children, class: _class } = $props<{
    title?: string;
    value?: unknown;
+    header?: Snippet;
    children?: Snippet;
    class?: string;
  }>();
@@ -11,7 +12,13 @@
 <section class="border-outline border-1/2 bg-layer-1 rounded border mb-4 p-4 flex flex-col gap-4 {_class}">
  <h3 class="flex gap-2 font-bold">
    {title}
-    <p class="font-normal! opacity-50!">{value}</p>
+    <div class="flex gap-4 w-full font-normal opacity-50 max-w-[75%] whitespace-pre overflow-hidden text-clip">
+      {#if header}
+        {@render header()}
+      {:else}
+        {value}
+      {/if}
+    </div>
  </h3>
  <div>
    {@render children()}
--- a/packages/ui/svelte.config.js
+++ b/packages/ui/svelte.config.js
@@ -11,7 +11,7 @@ const config = {

  kit: {
    paths: {
-      base: BASE_URL
+      base: BASE_URL === '/' ? '' : BASE_URL
    },
    // adapter-auto only supports some environments, see https://kit.svelte.dev/docs/adapter-auto for a list.
    // If your environment is not supported, or you settled on a specific environment, switch out the adapter.
--- a/packages/ui/vite.config.ts
+++ b/packages/ui/vite.config.ts
@@ -1,5 +1,6 @@
 import { sveltekit } from '@sveltejs/kit/vite';
 import tailwindcss from '@tailwindcss/vite';
+import { playwright } from '@vitest/browser-playwright';
 import { exec } from 'node:child_process';
 import { readFileSync } from 'node:fs';
 import { defineConfig } from 'vitest/config';
@@ -21,6 +22,31 @@ const postDevPackagePlugin = () => {
 export default defineConfig({
  plugins: [tailwindcss(), sveltekit(), postDevPackagePlugin()],
  test: {
-    include: ['src/**/*.{test,spec}.{js,ts}']
+    expect: { requireAssertions: true },
+    projects: [
+      {
+        extends: './vite.config.ts',
+        test: {
+          name: 'client',
+          browser: {
+            enabled: true,
+            provider: playwright(),
+            instances: [{ browser: 'firefox', headless: true }]
+          },
+          include: ['src/**/*.svelte.ts'],
+          exclude: ['src/lib/server/**']
+        }
+      },
+
+      {
+        extends: './vite.config.ts',
+        test: {
+          name: 'server',
+          environment: 'node',
+          include: ['src/**/*.{test,spec}.{js,ts}'],
+          exclude: ['src/**/*.svelte.{test,spec}.{js,ts}']
+        }
+      }
+    ]
  }
 });
--- a/packages/utils/package.json
+++ b/packages/utils/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@nodarium/utils",
-  "version": "0.0.1",
+  "version": "0.0.3",
  "description": "",
  "main": "src/index.ts",
  "scripts": {
@@ -12,11 +12,11 @@
  "author": "",
  "license": "ISC",
  "dependencies": {
-    "@nodarium/types": "workspace:"
+    "@nodarium/types": "workspace:^"
  },
  "devDependencies": {
    "dprint": "^0.51.1",
    "vite": "^7.3.1",
-    "vitest": "^4.0.17"
+    "vitest": "^4.0.18"
  }
 }
--- a/packages/utils/src/encoding.test.ts
+++ b/packages/utils/src/encoding.test.ts
@@ -5,7 +5,6 @@ test('encode_float', () => {
  const input = 1.23;
  const encoded = encodeFloat(input);
  const output = decodeFloat(encoded);
-  console.log(input, output);
  expect(output).toBeCloseTo(input);
 });

--- a/packages/utils/src/fastHash.test.ts
+++ b/packages/utils/src/fastHash.test.ts
@@ -21,24 +21,6 @@ test('fastHashArray doesnt product collisions', () => {
  expect(hash_a).not.toEqual(hash_b);
 });

-test('fastHashArray is fast(ish) < 20ms', () => {
-  const a = new Int32Array(10_000);
-
-  const t0 = performance.now();
-  fastHashArrayBuffer(a);
-
-  const t1 = performance.now();
-
-  a[0] = 1;
-
-  fastHashArrayBuffer(a);
-
-  const t2 = performance.now();
-
-  expect(t1 - t0).toBeLessThan(20);
-  expect(t2 - t1).toBeLessThan(20);
-});
-
 // test if the fastHashArray function is deterministic
 test('fastHashArray is deterministic', () => {
  const a = new Int32Array(1000);
--- a/packages/utils/src/flatTree.test.ts
+++ b/packages/utils/src/flatTree.test.ts
@@ -8,8 +8,6 @@ test('it correctly concats nested arrays', () => {

  const output = concatEncodedArrays([input_a, input_b, input_c]);

-  console.log('Output', output);
-
  const decoded = decodeNestedArray(output);

  expect(decoded[0]).toEqual([1, 2, 3]);
--- a/packages/utils/src/flatTree.ts
+++ b/packages/utils/src/flatTree.ts
@@ -88,7 +88,7 @@ function decode_recursive(dense: number[] | Int32Array, index = 0) {
          dense,
          index
        );
-        decoded.push(...p);
+        decoded.push(p as number[]);
        index = nextIndex + 1;
        nextBracketIndex = _nextBracketIndex;
      } else {
--- a/pnpm-lock.yaml
+++ b/pnpm-lock.yaml
Author	SHA1	Message	Date
release-bot	2e6466ceca	chore: update dprint linters All checks were successful 🚀 Lint & Test & Deploy / release (pull_request) Successful in 4m17s Details	2026-02-09 01:58:05 +01:00
release-bot	20d8e2abed	feat(theme): improve light theme a bit	2026-02-09 01:57:32 +01:00
release-bot	715e1d095b	feat(theme): merge edge and connection color All checks were successful 🚀 Lint & Test & Deploy / release (pull_request) Successful in 3m35s Details	2026-02-09 01:35:41 +01:00
release-bot	07e2826f16	feat(ui): improve colors of input shape	2026-02-09 00:52:35 +01:00
release-bot	e0ad97b003	feat(ui): highlight circle on hover on InputShape All checks were successful 🚀 Lint & Test & Deploy / release (pull_request) Successful in 3m53s Details	2026-02-09 00:21:58 +01:00
release-bot	93df4a19ff	fix(ci): handle newline in commit messages for git.json All checks were successful 🚀 Lint & Test & Deploy / release (pull_request) Successful in 3m41s Details	2026-02-09 00:09:28 +01:00
release-bot	d661a4e4a9	feat(ui): improve InputShape ux All checks were successful 🚀 Lint & Test & Deploy / release (pull_request) Successful in 4m17s Details Allow interactions in mirrored side aswell. Use rightclick to delete circles.	2026-02-08 23:59:39 +01:00
release-bot	c7f808ce2d	wip	2026-02-08 22:56:41 +01:00
release-bot	72d6cd6ea2	feat(ui): add initial InputShape element	2026-02-08 21:59:43 +01:00
release-bot	615f2d3c48	feat(ui): allow custom snippets in ui section header	2026-02-08 21:59:00 +01:00
release-bot	2fadb6802d	refactor: make changelog code simpler	2026-02-08 21:58:01 +01:00
release-bot	13c83efdb9	fix(app): handle error while parsing changelog	2026-02-08 21:00:30 +01:00
release-bot	e44b73bebf	feat: optimize changelog display All checks were successful 🚀 Lint & Test & Deploy / release (push) Successful in 4m5s Details - Hide releases under a Detail - Hide all commits under a Detail	2026-02-08 19:04:56 +01:00
Max Richter	979e9fd922	feat: improve changelog readbility Some checks failed 🚀 Lint & Test & Deploy / release (push) Failing after 2m41s Details	2026-02-07 17:40:49 +01:00
Max Richter	544500e7fe	chore: remove pgp from changelog All checks were successful Build & Push CI Image / build-and-push (push) Successful in 8m48s Details 🚀 Lint & Test & Deploy / release (push) Successful in 4m13s Details	2026-02-07 16:58:06 +01:00
Max Richter	aaebbc4bc0	fix: some stuff with ci	2026-02-07 16:57:50 +01:00
release-bot	894ab70b79	chore(release): v0.0.3	2026-02-07 15:56:02 +00:00
Max Richter	f8a2a95bc1	chore: clean CHANGELOG.md Some checks failed Build & Push CI Image / build-and-push (push) Has been cancelled Details 🚀 Lint & Test & Deploy / release (push) Successful in 4m14s Details	2026-02-07 16:32:19 +01:00
Max Richter	c9dd143916	fix(ci): correctly add release notes from tag to changelog	2026-02-07 16:29:59 +01:00
Max Richter	898dd49aee	fix(ci): correctly copy changelog to build output All checks were successful 🚀 Lint & Test & Deploy / release (push) Successful in 4m7s Details	2026-02-07 16:20:28 +01:00
Max Richter	9fb69d760f	feat: show commits since last release in changelog All checks were successful 🚀 Lint & Test & Deploy / release (push) Successful in 4m5s Details	2026-02-07 16:15:48 +01:00
Max Richter	bafbcca2b8	fix: wrong socket was highlighted when dragging node The old code had a bug that highlighted a socket from a node to which a edge already exists which could not be connected to	2026-02-07 16:15:48 +01:00
Max Richter	8ad9e5535c	feat: highlight possible sockets when dragging edge Closes #14	2026-02-07 16:15:44 +01:00
release-bot	43a3c54838	chore(release): v0.0.3	2026-02-07 15:14:21 +00:00
Max Richter	11eaeb719b	feat(app): display some git metadata in changelog All checks were successful 🚀 Lint & Test & Deploy / release (push) Successful in 3m35s Details	2026-02-06 16:30:21 +01:00
Max Richter	74c2978cd1	chore: cleanup git.json a bit	2026-02-06 16:16:07 +01:00
Max Richter	4fdc247904	ci: update build.sh to correct git.json All checks were successful 🚀 Lint & Test & Deploy / release (push) Successful in 4m21s Details	2026-02-06 15:57:19 +01:00
Max Richter	c3f8b4b5aa	ci: debug available env vars All checks were successful 🚀 Lint & Test & Deploy / release (push) Successful in 3m31s Details	2026-02-06 15:53:08 +01:00
Max Richter	67591c0572	chore: pnpm format All checks were successful 🚀 Lint & Test & Deploy / release (push) Successful in 4m3s Details	2026-02-06 15:46:54 +01:00
Max Richter	de1f9d6ab6	feat(ui): change inputnumber to snap to values when alt is pressed Some checks failed 🚀 Lint & Test & Deploy / release (push) Has been cancelled Details	2026-02-06 15:44:24 +01:00
Max Richter	6acce72fb8	fix(ui): correctly initialize InputNumber When the value is outside min/max the value should not be clamped.	2026-02-06 15:25:18 +01:00
Max Richter	cf8943b205	chore: pnpm update	2026-02-06 15:18:32 +01:00
Max Richter	9e03d36482	chore: use newest ci image All checks were successful 🚀 Lint & Test & Deploy / release (push) Successful in 3m55s Details	2026-02-06 15:06:39 +01:00
Max Richter	fd7268d620	ci: make dockerfile work Some checks failed Build & Push CI Image / build-and-push (push) Successful in 8m42s Details 🚀 Lint & Test & Deploy / release (push) Failing after 2m31s Details	2026-02-06 14:43:31 +01:00
Max Richter	6358c22a85	ci: use tagged own image for ci Some checks failed 🚀 Lint & Test & Deploy / release (push) Failing after 3m17s Details	2026-02-06 13:22:33 +01:00
Max Richter	655b6a18b2	ci: make dockerfile work Some checks failed Build & Push CI Image / build-and-push (push) Successful in 9m11s Details 🚀 Lint & Test & Deploy / release (push) Has been cancelled Details	2026-02-06 13:10:41 +01:00
Max Richter	37b2bdc8bd	ci: update ci Dockerfile to work Some checks failed Build & Push CI Image / build-and-push (push) Failing after 1m24s Details 🚀 Lint & Test & Deploy / release (push) Failing after 2m23s Details	2026-02-06 12:52:42 +01:00
Max Richter	94e01d4ea8	ci: correctly build and push ci image Some checks failed Build & Push CI Image / build-and-push (push) Failing after 1m0s Details 🚀 Lint & Test & Deploy / release (push) Has been cancelled Details	2026-02-06 12:50:34 +01:00
Max Richter	35f5177884	feat: try to optimize the Dockerfile Some checks failed Build & Push CI Image / build-and-push (push) Failing after 9s Details 🚀 Lint & Test & Deploy / release (push) Failing after 2m31s Details	2026-02-06 12:33:36 +01:00
Max Richter	ac2c61f221	ci: use actual git url in ci Some checks failed 🚀 Lint & Test & Deploy / release (push) Failing after 2m16s Details	2026-02-06 12:22:51 +01:00
Max Richter	ef3d46279f	fix(ci): build before testing	2026-02-06 11:59:43 +01:00
Max Richter	703da324fa	ci: automatically build ci image and store locally Some checks failed Build & Push CI Image / build-and-push (push) Failing after 3m6s Details 🚀 Lint & Test & Deploy / release (push) Failing after 1m59s Details	2026-02-06 11:57:44 +01:00
Max Richter	1dae472253	ci: add a git.json metadata file during build Some checks failed 🚀 Lint & Test & Deploy / release (push) Failing after 3m14s Details	2026-02-06 11:48:12 +01:00
Max Richter	09fdfb88cd	chore: update test screenshots All checks were successful 🚀 Lint & Test & Deploy / release (push) Successful in 4m35s Details	2026-02-06 00:53:58 +01:00
Max Richter	04b63cc7e2	feat: add changelog to sidebar Some checks failed 🚀 Lint & Test & Deploy / release (push) Failing after 4m36s Details	2026-02-06 00:45:33 +01:00
Max Richter	cb6a35606d	feat(ci): also cache cargo stuff All checks were successful 🚀 Lint & Test & Deploy / release (push) Successful in 4m15s Details	2026-02-04 21:13:10 +01:00
Max Richter	9c9f3ba3b7	fix(ci): use GITHUB_ instead of GITEA_ for env vars Some checks failed 🚀 Lint & Test & Deploy / release (push) Has been cancelled Details	2026-02-04 20:39:22 +01:00
Max Richter	08dda2b2cb	chore: pnpm format Some checks failed 🚀 Lint & Test & Deploy / release (push) Failing after 4m46s Details	2026-02-04 20:30:59 +01:00
Max Richter	059129a738	fix(ci): deploy prs and main Some checks failed 🚀 Lint & Test & Deploy / release (push) Failing after 1m45s Details	2026-02-04 20:28:41 +01:00
Max Richter	437c9f4a25	feat(ci): add list of all commits to changelog entry	2026-02-04 20:14:38 +01:00
Max Richter	48bf447ce1	docs: straighten up changelog a bit	2026-02-04 20:08:29 +01:00
Max Richter	548fa4f0a1	fix(app): correctly initialize vec3 inputs in nestedsettings Closes #32	2026-02-04 20:08:04 +01:00
release-bot	642cca30ad	chore(release): v0.0.2	2026-02-04 18:37:09 +00:00
release-bot	419249aca3	chore(release): v0.0.2 Some checks failed 🚀 Release / release (push) Failing after 4m24s Details	2026-02-03 23:40:36 +00:00
Max Richter	c69cb94ac7	fix(ci): actually deploy on tags All checks were successful 🚀 Release / release (push) Successful in 4m12s Details	2026-02-04 00:34:39 +01:00
release-bot	4b652d885f	chore(release): v0.0.2	2026-02-03 22:05:51 +00:00
Max Richter	381f784775	fix(app): correctly handle false value in settings All checks were successful 🚀 Release / release (push) Successful in 4m30s Details This caused a bug where random seed could not be false.	2026-02-03 22:46:43 +01:00
Max Richter	91866b4e9a	feat/e2e-testing (#31 ) All checks were successful 🚀 Release / release (push) Successful in 4m7s Details Reviewed-on: #31 Co-authored-by: Max Richter <max@max-richter.dev> Co-committed-by: Max Richter <max@max-richter.dev>	2026-02-03 22:29:43 +01:00
Max Richter	01f1568221	fix(ci): auto format changelog.md after release All checks were successful 🚀 Release / release (push) Successful in 3m41s Details	2026-02-03 15:47:38 +01:00
Max Richter	3e8d2768b3	chore: format Some checks failed 🚀 Release / release (push) Failing after 1m42s Details	2026-02-03 15:43:47 +01:00
Max Richter	16a832779a	chore(ci): make release script work with sh	2026-02-03 15:43:47 +01:00
Max Richter	d582915842	chore(ci): add jq and git to ci docker image	2026-02-03 15:43:47 +01:00
release-bot	caaecd7a02	chore(release): v0.0.1	2026-02-03 14:43:26 +00:00